SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	27	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * malonyl	C(=O)C(C)C=CC=C(C)C=CCC(C)C=CC=CCO	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)C(C)C=CC=C(C)C=CCC(C)C=CC=CCO Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	12	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl	C(C)C(O)C(C)C=CC(O)C(C)CC(C)C(O)C(C)C(=O)C(C)C(=O)O	Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C(O)C(C)C=CC(O)C(C)CC(C)C(O)C(C)C(=O)C(C)C(=O)O Postsynthetic modifications Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	6	2	nrps	Show	Open	Show	Scaffold Input	V * V * V * V * V * V * S	N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:1
Smiles N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:1 Figure
	1	1	nrps	Show	Open	Show	Scaffold Input	V * A * F * T * T	N[C@H](C(C)C)C(=O)N[C@H](C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N(C)[C@H](C(O)C)C(=O)N[C@H](C(O)C)	None
Smiles N[C@H](C(C)C)C(=O)N[C@H](C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N(C)[C@H](C(O)C)C(=O)N[C@H](C(O)C) Postsynthetic modifications None Figure
	29	1	nrps	Show	Open	Show	Scaffold Input	W * S * horn * W * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CO)C(=O)N[C@H](CCCNO)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CO)C(=O)N[C@H](CCCNO)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	6	1	pks	Show	Open	Show	Scaffold Input	malonyl * malonyl * malonyl * malonyl * methylmalonyl	CC=CC=CC(=O)CC=C(C)CO	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:1
Smiles CC=CC=CC(=O)CC=C(C)CO Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:1 Figure
	24	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * unknown * malonyl	CC(C)C(O)C(*)C=C	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC(C)C(O)C()C=C Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	7	1	nrps	Show	Open	Show	Scaffold Input	L * E	N[C@H](CC(C)C)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](CC(C)C)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	22	1	nrps	Show	Open	Show	Scaffold Input	aad * E	N[C@H](CCCC(=O)O)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](CCCC(=O)O)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	8	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * A	CC(=O)N[C@H](C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC(=O)N[C@H](C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 40 entries

Previous1 2 3 4Next

Uploaded File: None

Record: NZ_CP029194.1

Comment: NZ_CP029194.1 Streptomyces venezuelae strain ATCC 15068 chromosome, complete genome

Change record: 0