SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	22	1	nrps	Show	Open	Show	Scaffold Input	S * T * W * D * dhb * aad * dhb * hpg * D * G * N * E * W	C(=O)N[C@H](CO)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CC(=O)O)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](CCCC(=O)O)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)N[C@@H](CC(=O)N)C(=O)N[C@H](CCC(=O)O)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](CO)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CC(=O)O)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](CCCC(=O)O)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)N[C@@H](CC(=O)N)C(=O)N[C@H](CCC(=O)O)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	26	1	nrps-pks	Show	Open	Show	Scaffold Input	F * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl	N[C@H](Cc1ccccc1)C=CC=CC=CC=CC=CC(O)CC=CC=CC=CC=CC(=O)O	Glyco:1 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C=CC=CC=CC=CC=CC(O)CC=CC=CC=CC=CC(=O)O Postsynthetic modifications Glyco:1 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	1	1	nrps-pks	Show	Open	Show	Scaffold Input	F * malonyl * dhb * methylmalonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl	N[C@H](Cc1ccccc1)Oc1c(O)c(ccc1)C(=O)C(C)C(=O)CC(O)C(C)C(O)CC(O)CCCC(=O)CC(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)Oc1c(O)c(ccc1)C(=O)C(C)C(=O)CC(O)C(C)C(O)CC(O)CCCC(=O)CC(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	28	1	nrps	Show	Open	Show	Scaffold Input	S * T * horn	N[C@@H](CO)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CCCNO)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@@H](CO)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CCCNO) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	29	1	nrps	Show	Open	Show	Scaffold Input	dhb * C * C	Oc1c(O)c(ccc1)C(=O)N[C@H](CS)C(=O)N[C@H](CS)C(=O)O	None
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](CS)C(=O)N[C@H](CS)C(=O)O Postsynthetic modifications None Figure
	21	1	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	11	1	nrps	Show	Open	Show	Scaffold Input	A * E	N[C@H](C)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](C)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	23	1	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	8	1	nrps	Show	Open	Show	Scaffold Input	F	N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	9	1	pks	Show	Open	Show	Scaffold Input	malonyl	C	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 31 entries

Previous1 2 3 4Next

Uploaded File: None

Record: NZ_CP039123.1

Comment: NZ_CP039123.1 Streptomyces sp. SS52 chromosome, complete genome

Change record: 0