SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	22	1	nrps	Show	Open	Show	Scaffold Input	D * T * F * F * N * F * N * F * D * N * G * S * S * A * A * D * G * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](CC(=O)N)C(=O)NCC(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](CC(=O)N)C(=O)NCC(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	19	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl	C(C)C(O)C(C)C(O)C(C)C(O)C(C)C(O)C(C)C=CC(O)CC(O)CC(=O)CCCC=CC(O)CC(O)C(C)C=CC(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles C(C)C(O)C(C)C(O)C(C)C(O)C(C)C(O)C(C)C=CC(O)CC(O)CC(=O)CCCC=CC(O)CC(O)C(C)C=CC(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	36	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * unknown * unknown * unknown * unknown * unknown * S * S * unknown * G * unknown * unknown	C(C)C=C()C=C()C=C()C(O)C()C(=O)C()C(=O)N[C@H](CO)C(=O)N(C)[C@H](CO)C(O)C()(C)C(=O)NCC(O)C()C(O)C()	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C=C()C=C()C=C()C(O)C()C(=O)C()C(=O)N[C@H](CO)C(=O)N(C)[C@H](CO)C(O)C()(C)C(=O)NCC(O)C()C(O)C() Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	1	1	nrps	Show	Open	Show	Scaffold Input	S * S * D * V * G * N * F * F * G	C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](C(C)C)C(=O)NCC(=O)N[C@H](CC(=O)N)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)NC	None
Smiles C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](C(C)C)C(=O)NCC(=O)N[C@H](CC(=O)N)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)NC Postsynthetic modifications None Figure
	19	2	pks	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl	C=C(C)C=C(C)C=CC(O)CC(O)CC(O)C	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles C=C(C)C=C(C)C=CC(O)CC(O)CC(O)C Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	40	1	nrps	Show	Open	Show	Scaffold Input	W * S * horn * S * horn	N(C)[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CO)C(=O)N(C)[C@H](CCCNO)C(=O)N[C@H](CO)C(=O)N[C@@H](CCCNO)	None
Smiles N(C)[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CO)C(=O)N(C)[C@H](CCCNO)C(=O)N[C@H](CO)C(=O)N[C@@H](CCCNO) Postsynthetic modifications None Figure
	20	1	nrps	Show	Open	Show	Scaffold Input	S * F * F	N[C@H](CO)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)O	None
Smiles N[C@H](CO)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)O Postsynthetic modifications None Figure
	4	1	pks	Show	Open	Show	Scaffold Input	unknown * methylmalonyl	C(=O)C(*)CC(C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)C()CC(C) Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	27	1	nrps	Show	Open	Show	Scaffold Input	F * F	C(=O)N[C@H](Cc1ccccc1)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](Cc1ccccc1)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 47 entries

Previous1 2 3 4 5Next

Uploaded File: None

Record: NZ_CP028369.1

Comment: NZ_CP028369.1 Streptomyces sp. P3 chromosome, complete genome

Change record: 0