SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	35	2	pks	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl	C(C)C(O)C(C)C=CC(O)CC(O)CC(O)CC=C(C)C(O)CC=CC=CC=CC(O)CC(O)CC=CC=CC=CC=CC=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles C(C)C(O)C(C)C=CC(O)CC(O)CC(O)CC=C(C)C(O)CC=CC=CC=CC(O)CC(O)CC=CC=CC=CC=CC=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	20	2	nrps	Show	Open	Show	Scaffold Input	dhb * F * P * S * D * P * F * F * P * F * G * P * G	Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](C1CCCN1)C(=O)NCC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](C1CCCN1)C(=O)NCC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	40	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * ethylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * ethylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * ethylmalonyl * malonyl	C(C)C=C(CC)CC(C)C=C(C)CC(C)C(O)C(CC)C=C(C)C(O)C(C)C=C(C)CC(CC)C(=O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C=C(CC)CC(C)C=C(C)CC(C)C(O)C(CC)C=C(C)C(O)C(C)C=C(C)CC(CC)C(=O)CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	5	1	nrps	Show	Open	Show	Scaffold Input	D * S * T * T * S * G * P * W * W * L * P	C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](CO)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CO)C(=O)NCC(=O)N[C@H](C1CCCN1)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C1CCCN1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](CO)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CO)C(=O)NCC(=O)N[C@H](C1CCCN1)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C1CCCN1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	36	1	nrps	Show	Open	Show	Scaffold Input	F * hpg * W * L * hpg * F * Y * hpg * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](Cc1ccccc1)C(=O)O	Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](Cc1ccccc1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	6	2	nrps	Show	Open	Show	Scaffold Input	T * A * W * A * V * F * G * W * P	N(C)[C@H](C(O)C)C(=O)N[C@H](C)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](C)C(=O)N(C)[C@H](C(C)C)C(=O)N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](C1CCCN1)C(=O)O	None
Smiles N(C)[C@H](C(O)C)C(=O)N[C@H](C)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](C)C(=O)N(C)[C@H](C(C)C)C(=O)N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](C1CCCN1)C(=O)O Postsynthetic modifications None Figure
	27	1	nrps	Show	Open	Show	Scaffold Input	V * S * V * V * V * S	C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CO)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CO)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	7	1	nrps	Show	Open	Show	Scaffold Input	F * F * V * G * A	N[C@H](Cc1ccccc1)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)N[C@H](C(C)C)C(=O)NCC(=O)N[C@H](C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)N[C@H](C(C)C)C(=O)NCC(=O)N[C@H](C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	10	1	pks	Show	Open	Show	Scaffold Input	malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl	C(O)CC=C(C)C(=O)CC=C(C)C=C	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(O)CC=C(C)C(=O)CC=C(C)C=C Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	4	1	nrps	Show	Open	Show	Scaffold Input	F * V * dhb * F * V	C(=O)N[C@H](C(C)C)N[C@H](Cc1ccccc1)C(=O)N[C@H](C(C)C)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](C(C)C)N[C@H](Cc1ccccc1)C(=O)N[C@H](C(C)C)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 52 entries

Previous1 2 3 4 5 6Next

Uploaded File: None

Record: NZ_CP022685.1

Comment: NZ_CP022685.1 Streptomyces formicae strain KY5 chromosome, complete genome

Change record: 0