SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	1	1	nrps-pks	Show	Open	Show	Scaffold Input	F * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * methylmalonyl	N[C@H](Cc1ccccc1)C(O)CC=CC(O)CCC(C)C=C(C)C=CCCCC(C)C=C(C)C(O)CC(=O)CC=CCC	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:1
Smiles N[C@H](Cc1ccccc1)C(O)CC=CC(O)CCC(C)C=C(C)C=CCCCC(C)C=C(C)C(O)CC(=O)CC=CCC Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:1 Figure
	28	1	nrps	Show	Open	Show	Scaffold Input	hpg * F * V * W * F * hpg * F * Y * F * A	N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	25	2	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * S * G * V	CC(C)C(=O)CC(=O)N[C@H](CO)C(=O)NCC(=O)N[C@@H](C(C)C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC(C)C(=O)CC(=O)N[C@H](CO)C(=O)NCC(=O)N[C@@H](C(C)C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	1	2	pks	Show	Open	Show	Scaffold Input	malonyl * unknown * unknown * unknown	CC(=O)C()C(=O)C()C(=O)C(*)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:1
Smiles CC(=O)C()C(=O)C()C(=O)C()C(=O)O Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:1 Figure
	13	1	nrps	Show	Open	Show	Scaffold Input	F * dhb	N[C@H](Cc1ccccc1)C(=O)Oc1c(O)c(ccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)Oc1c(O)c(ccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	4	1	nrps	Show	Open	Show	Scaffold Input	S * G	C(=O)N[C@H](CO)C(=O)N(C)CCO	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](CO)C(=O)N(C)CCO Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	21	1	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	23	1	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	30	1	nrps	Show	Open	Show	Scaffold Input	W * K	C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CCCCN)CO	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CCCCN)CO Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	6	1	nrps	Show	Open	Show	Scaffold Input	F	N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure

Showing 1 to 10 of 34 entries

Previous1 2 3 4Next

Uploaded File: None

Record: NZ_CP011492.1

Comment: NZ_CP011492.1 Streptomyces sp. CNQ-509 chromosome, complete genome

Change record: 0