SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	26	1	pks	Show	Open	Show	Scaffold Input	malonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl	C(=O)C(C)C=CC(O)CC(O)CCCC(O)C(C)C(O)CCC(C)C(O)CC(O)CC(O)CCCC(O)C(C)C=C(C)C(O)CC(O)CCCC(O)C(C)C(O)CC=CC=C(C)C(O)C(C)C(O)CC(O)C(C)C(O)CC(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles C(=O)C(C)C=CC(O)CC(O)CCCC(O)C(C)C(O)CCC(C)C(O)CC(O)CC(O)CCCC(O)C(C)C=C(C)C(O)CC(O)CCCC(O)C(C)C(O)CC=CC=C(C)C(O)C(C)C(O)CC(O)C(C)C(O)CC(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	19	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * G * G * T * Y * T * V	C(=O)NCC(=O)NCC(=O)N[C@@H](C(O)C)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](C(C)C)C(=O)CC(O)CC=CC=CC(O)C(C)CC(C)C(O)C(C)C(O)CC(=O)O	Glyco:1 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)NCC(=O)NCC(=O)N[C@@H](C(O)C)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](C(C)C)C(=O)CC(O)CC=CC=CC(O)C(C)CC(C)C(O)C(C)C(O)CC(=O)O Postsynthetic modifications Glyco:1 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	19	3	nrps	Show	Open	Show	Scaffold Input	F * G * D * G * G	C(=O)N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)NCC(=O)O	Glyco:1 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)NCC(=O)O Postsynthetic modifications Glyco:1 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	21	1	nrps	Show	Open	Show	Scaffold Input	F * aad * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	25	1	nrps	Show	Open	Show	Scaffold Input	S * T * horn	N[C@@H](CO)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CCCNO)	None
Smiles N[C@@H](CO)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CCCNO) Postsynthetic modifications None Figure
	17	1	nrps	Show	Open	Show	Scaffold Input	L * E	N[C@H](CC(C)C)C(=O)N[C@H](CCC(=O)O)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC(C)C)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	11	1	nrps	Show	Open	Show	Scaffold Input	A * E	N[C@H](C)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](C)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	19	2	nrps	Show	Open	Show	Scaffold Input	T * hpg	C(=O)N[C@H](C(O)C)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)O	Glyco:1 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](C(O)C)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)O Postsynthetic modifications Glyco:1 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	12	1	nrps	Show	Open	Show	Scaffold Input	D * E	N[C@H](CC(=O)O)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](CC(=O)O)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	27	1	nrps-pks	Show	Open	Show	Scaffold Input	F * malonyl	N[C@H](Cc1ccccc1)CC(C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)CC(C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 31 entries

Previous1 2 3 4Next

Uploaded File: None

Record: NZ_CP012382.1

Comment: NZ_CP012382.1 Streptomyces ambofaciens ATCC 23877 chromosome, complete genome

Change record: 0 1