SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	33	2	pks	Show	Open	Show	Scaffold Input	malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl	CC(O)CC=CC=CC=CC=CC=C(C)C=CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)C(C)C(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC(O)CC=CC=CC=CC=CC=C(C)C=CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)C(C)C(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	29	2	nrps	Show	Open	Show	Scaffold Input	S * S * dhb * A * S * N * T * G * T * N * A * G	C(=O)N[C@@H](CO)C(=O)N[C@H](CO)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](C)C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](C(O)C)C(=O)NCC(=O)N[C@H](C(O)C)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](C)C(=O)NCC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@@H](CO)C(=O)N[C@H](CO)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](C)C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](C(O)C)C(=O)NCC(=O)N[C@H](C(O)C)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](C)C(=O)NCC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	3	2	nrps	Show	Open	Show	Scaffold Input	F * G * F * A * F * C * G * S * orn * S	N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CS)C(=O)NCC(=O)N[C@H](CO)C(=O)N[C@H](CCCN)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CS)C(=O)NCC(=O)N[C@H](CO)C(=O)N[C@H](CCCN)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	33	1	nrps	Show	Open	Show	Scaffold Input	L * A * V * A * L * orn * T * orn * V * L	N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C)	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C) Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	8	2	nrps	Show	Open	Show	Scaffold Input	T * S * V * F * L * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](C(C)C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](C(C)C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	5	1	nrps	Show	Open	Show	Scaffold Input	A * F * F * F * T * F	N[C@H](C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	10	1	nrps	Show	Open	Show	Scaffold Input	V * V * V * V * V	N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	1	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * L * V * V	CC(=O)N[C@H](CC(C)C)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC(=O)N[C@H](CC(C)C)N[C@H](C(C)C)C(=O)N[C@H](C(C)C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	12	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * F * A	N[C@H](C)C=CC(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C)C=CC(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	31	1	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure

Showing 1 to 10 of 47 entries

Previous1 2 3 4 5Next

Uploaded File: None

Record: NZ_AP018517.1

Comment: NZ_AP018517.1 Streptomyces rochei strain 7434AN4

Change record: 0