This site makes heavy use of Javascript.

In your browser, Javascript is either unsupported or deactivated. To make full use of this site, please either update your browser to a current version or activate Javascript. Also consider deactivating browser addons that can intefere with script execution for this site, such as NoScript for Firefox.

Uploaded File: None

Record: NZ_CP048875.1

Comment: NZ_CP048875.1 Streptomyces albus strain CAS922 chromosome, complete genome

Change record: 0

Genome browser

Open genome browser

Project

Download project folder

Debug

Download Log

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	6	1	nrps-pks	Show	Open	Show	Scaffold Input	A * methylmalonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl	N[C@H](C)C(O)C(C)C(O)CC=CC=CC(O)C(C)C(O)CC(O)C(C)C(O)CC(O)CC(=O)CC(O)C(C)CCC(O)CC(O)CC=CC=CC(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C)C(O)C(C)C(O)CC=CC=CC(O)C(C)C(O)CC(O)C(C)C(O)CC(O)CC(=O)CC(O)C(C)CCC(O)CC(O)CC=CC=CC(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	24	1	nrps-pks	Show	Open	Show	Scaffold Input	N * methylmalonyl * methylmalonyl * malonyl * malonyl * F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)N[C@H](CC(=O)N)C(=O)C(C)C(O)C(C)C(O)CC(=O)C	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)N[C@H](CC(=O)N)C(=O)C(C)C(O)C(C)C(O)CC(=O)C Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * methylmalonyl * malonyl * malonyl	C(C)C=CC(O)C(C)C(O)CC(O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C=CC(O)C(C)C(O)CC(O)CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	31	1	nrps	Show	Open	Show	Scaffold Input	V * S * T	N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)N[C@H](C(O)C)	None
Smiles N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)N[C@H](C(O)C) Postsynthetic modifications None Figure
	1	1	nrps	Show	Open	Show	Scaffold Input	dhb * S * C	Oc1c(O)c(ccc1)C(=O)N[C@H](CO)C(=O)N[C@H](CS)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](CO)C(=O)N[C@H](CS) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	3	1	nrps	Show	Open	Show	Scaffold Input	dhb * S	Oc1c(O)c(ccc1)C(=O)N[C@H](CO)C(=O)O	None
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications None Figure
	2	2	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * V	N[C@H](C(C)C)CC(C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C(C)C)CC(C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	29	2	nrps	Show	Open	Show	Scaffold Input	L * E	N[C@H](CC(C)C)C(=O)N[C@H](CCC(=O)O)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC(C)C)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	5	1	nrps	Show	Open	Show	Scaffold Input	F	N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	2	3	nrps	Show	Open	Show	Scaffold Input	F	N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 38 entries

Previous1 2 3 4Next