SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	29	2	nrps	Show	Open	Show	Scaffold Input	L * A * V * A * L * orn * T * orn * V * L	N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	30	1	nrps	Show	Open	Show	Scaffold Input	hpg * hpg * W * hpg * hpg * Y * Y * W * F * D	C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)O)C(=O)O	None
Smiles C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)O)C(=O)O Postsynthetic modifications None Figure
	26	1	nrps	Show	Open	Show	Scaffold Input	F * P * F * G * F * N * T * hpg * orn * G	C(=O)N[C@H](C(O)C)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](CCCN)C(=O)NCC(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C1CCCN1)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)N)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](C(O)C)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](CCCN)C(=O)NCC(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C1CCCN1)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)N)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	21	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl	C(C)C=CCC(C)C=CC=CC=CC=CC=C(C)C=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C=CCC(C)C=CC=CC=CC=CC=C(C)C=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * ethylmalonyl * methylmalonyl * methylmalonyl * malonyl * ethylmalonyl * V * T	C(=O)N[C@H](C(O)C)C(=O)C(C)C=C(C)C(=O)C(CC)C=C(C)C(O)C(C)CCC(=O)C(CC)C(=O)N[C@H](C(C)C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](C(O)C)C(=O)C(C)C=C(C)C(=O)C(CC)C=C(C)C(O)C(C)CCC(=O)C(CC)C(=O)N[C@H](C(C)C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	1	1	nrps-pks	Show	Open	Show	Scaffold Input	W * L * W * A * V * unknown * L	C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](C)C(=O)N[C@H](C(C)C)C(=O)C(*)C(=O)N[C@@H](CC(C)C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](C)C(=O)N[C@H](C(C)C)C(=O)C()C(=O)N[C@@H](CC(C)C) Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	2	nrps	Show	Open	Show	Scaffold Input	F * A * S * S * A * G	N[C@H](Cc1ccccc1)C(=O)N[C@@H](C)C(=O)N[C@H](CO)C(=O)N(C)[C@@H](CO)C(=O)N[C@H](C)C(=O)NCC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@@H](C)C(=O)N[C@H](CO)C(=O)N(C)[C@@H](CO)C(=O)N[C@H](C)C(=O)NCC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	20	1	nrps-pks	Show	Open	Show	Scaffold Input	F * unknown * dhb * E	N[C@H](Cc1ccccc1)C(=O)C(*)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](CCC(=O)O)	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)C()C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications Glyco:3 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	3	2	nrps	Show	Open	Show	Scaffold Input	Y * L * A * dhb	Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	23	1	nrps	Show	Open	Show	Scaffold Input	V * W * V	N[C@H](C(C)C)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](C(C)C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C(C)C)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](C(C)C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 41 entries

Previous1 2 3 4 5Next

Uploaded File: None

Record: NZ_CP029617.1

Comment: NZ_CP029617.1 Streptomyces sp. WAC 01529 chromosome, complete genome

Change record: 0