SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	15	1	nrps-pks	Show	Open	Show	Scaffold Input	Q * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * methylmalonyl	N[C@H](CCC(=O)N)C(O)CC(O)CC=CC(O)CC(O)CC=CC=CC(O)CC(O)CC=CC(O)C(C)C(O)CC=CC=CC=CC=CC(O)C(C)C(O)C(C)C=CCCC=CC=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CCC(=O)N)C(O)CC(O)CC=CC(O)CC(O)CC=CC=CC(O)CC(O)CC=CC(O)C(C)C(O)CC=CC=CC=CC=CC(O)C(C)C(O)C(C)C=CCCC=CC=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	1	3	pks	Show	Open	Show	Scaffold Input	malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl	C(=O)CC(O)CC(O)C(C)C=CC=CC=CC=CC=CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CCCC(O)CC=CC(O)CC=CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:1
Smiles C(=O)CC(O)CC(O)C(C)C=CC=CC=CC=CC=CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CCCC(O)CC=CC(O)CC=CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:1 Figure
	1	2	nrps-pks	Show	Open	Show	Scaffold Input	dhb * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl	Oc1c(O)c(ccc1)C(C)C(O)CC(O)CC=CCCC=CCCCCC=CCCC=CCCC(O)CC(O)CC(=O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:1
Smiles Oc1c(O)c(ccc1)C(C)C(O)CC(O)CC=CCCC=CCCCCC=CCCC=CCCC(O)CC(O)CC(=O)CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:1 Figure
	42	1	pks	Show	Open	Show	Scaffold Input	malonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl	CC(=O)C(C)CC(C)C=CCC(C)C=C(C)CCC=C(C)CC(C)C(O)C(C)C(O)CC(O)CC(O)CCC(C)C=C(C)C(O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:3 * Sphingo:0 * 5-Ring:3
Smiles CC(=O)C(C)CC(C)C=CCC(C)C=C(C)CCC=C(C)CC(C)C(O)C(C)C(O)CC(O)CC(O)CCC(C)C=C(C)C(O)CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:3 * Sphingo:0 * 5-Ring:3 Figure
	26	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * A * F	N[C@H](C)C(=O)N[C@H](Cc1ccccc1)C(=O)CC(O)C(C)C=C(C)C=CC(O)C(C)CCC=C(C)C=CC(O)C(C)C=C(C)C(O)C(C)C=C(C)C(=O)C(C)C(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C)C(=O)N[C@H](Cc1ccccc1)C(=O)CC(O)C(C)C=C(C)C=CC(O)C(C)CCC=C(C)C=CC(O)C(C)C=C(C)C(O)C(C)C=C(C)C(=O)C(C)C(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	37	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * methylmalonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * V * T * G	C(C)C=CC=CC=CC=CC=C(C)C=CC=CC=CC(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(O)C)C(=O)NCC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles C(C)C=CC=CC=CC=CC=C(C)C=CC=CC=CC(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(O)C)C(=O)NCC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	47	2	pks	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * malonyl	C(C)C(=O)C(C)C(O)C(C)CC(C)C(O)C(C)C=C(C)C=CC(O)CCC(C)C=C(C)C=CC(=O)CC(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C(=O)C(C)C(O)C(C)CC(C)C(O)C(C)C=C(C)C=CC(O)CCC(C)C=C(C)C=CC(=O)CC(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	33	1	pks-nrps	Show	Open	Show	Scaffold Input	unknown * unknown * T * T * methylmalonyl * methylmalonyl * methylmalonyl * unknown * G * unknown * unknown	C(O)C()C(=O)C()C(=O)N[C@H](C(O)C)C(=O)N(C)[C@H](C(O)C)C(=O)C(C)C=C(C)C=C(C)C(=O)C()(C)C(=O)NCC=C()C(O)C(*)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(O)C()C(=O)C()C(=O)N[C@H](C(O)C)C(=O)N(C)[C@H](C(O)C)C(=O)C(C)C=C(C)C=C(C)C(=O)C()(C)C(=O)NCC=C()C(O)C() Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	5	1	nrps	Show	Open	Show	Scaffold Input	L * A * V * A * L * orn * T * orn * V * L	N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	37	3	nrps-pks	Show	Open	Show	Scaffold Input	F * malonyl * methylmalonyl * malonyl * F * methylmalonyl	N[C@H](Cc1ccccc1)C=CC=C(C)C(O)CC(=O)N[C@H](Cc1ccccc1)C(=O)C(C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C=CC=C(C)C(O)CC(=O)N[C@H](Cc1ccccc1)C(=O)C(C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 59 entries

Previous1 2 3 4 5 6Next

Uploaded File: None

Record: NZ_CP058693.1

Comment: NZ_CP058693.1 Streptomyces sp. Rer75 chromosome

Change record: 0