SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	50	1	nrps	Show	Open	Show	Scaffold Input	hpg * hpg * hpg * hpg * hpg * hpg * F * F * F * D * G * F * F * G * L * F * P	N[C@H](C1CCCN1)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)N(C)CC(=O)N(C)[C@H](CC(C)C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)O)C(=O)N(C)CC(=O)N[C@H](Cc1ccccc1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C1CCCN1)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)N(C)CC(=O)N(C)[C@H](CC(C)C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)O)C(=O)N(C)CC(=O)N[C@H](Cc1ccccc1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	4	1	nrps-pks	Show	Open	Show	Scaffold Input	dhb * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl	Oc1c(O)c(ccc1)C(=O)CC(O)CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CC(O)CCCCCC=CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)CC(O)CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CC(O)CCCCCC=CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	23	1	nrps	Show	Open	Show	Scaffold Input	orn * orn * orn * F * T * N * orn * orn * T * F	C(=O)N[C@H](CCCN)C(=O)N[C@@H](CCCN)C(=O)N[C@@H](CCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CCCN)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)O	None
Smiles C(=O)N[C@H](CCCN)C(=O)N[C@@H](CCCN)C(=O)N[C@@H](CCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CCCN)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)O Postsynthetic modifications None Figure
	20	1	nrps	Show	Open	Show	Scaffold Input	G * L * V * orn * orn * F * T * aad * V	C(=O)N[C@H](C(O)C)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](C(C)C)C(=O)NCC(=O)N[C@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](CCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)O	Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](C(O)C)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](C(C)C)C(=O)NCC(=O)N[C@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](CCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	14	1	nrps	Show	Open	Show	Scaffold Input	hpg * W * hpg * hpg * hpg * Y * hpg * F	C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N(C)[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](Cc1ccccc1)C(=O)O	Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N(C)[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](Cc1ccccc1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	2	nrps	Show	Open	Show	Scaffold Input	T * A * Y * F * L * A	N(C)[C@H](C(O)C)C(=O)N[C@@H](C)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N(C)[C@H](C(O)C)C(=O)N[C@@H](C)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	21	1	pks-nrps	Show	Open	Show	Scaffold Input	unknown * F * F * F * V	N[C@H](Cc1ccccc1)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C(C)C)C(=O)C(*)CO	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C(C)C)C(=O)C()CO Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	47	1	nrps-pks	Show	Open	Show	Scaffold Input	F * malonyl * hpg * L * unknown	C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](CC(C)C)C(=O)C(*)N[C@H](Cc1ccccc1)C(O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](CC(C)C)C(=O)C()N[C@H](Cc1ccccc1)C(O)CC(=O)O Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	27	1	nrps	Show	Open	Show	Scaffold Input	F * F * G * F	C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](Cc1ccccc1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](Cc1ccccc1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	3	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * malonyl * malonyl	C=C(C)C(O)CC=CC(=O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C=C(C)C(O)CC=CC(=O)CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 59 entries

Previous1 2 3 4 5 6Next

Uploaded File: None

Record: NZ_CP025551.1

Comment: NZ_CP025551.1 Streptomyces rimosus strain WT5260 chromosome, complete genome

Change record: 0 1