SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	13	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * F * malonyl * malonyl * malonyl * malonyl * W	N[C@H](CC1=CNC(=C12)C=CC=C2)N[C@H](Cc1ccccc1)C=CC=CC=CC=CC=CC=CC(O)CC=C(C)C=CC=CC=CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC1=CNC(=C12)C=CC=C2)N[C@H](Cc1ccccc1)C=CC=CC=CC=CC=CC=CC(O)CC=C(C)C=CC=CC=CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	12	2	nrps	Show	Open	Show	Scaffold Input	L * S * F * aad * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	11	1	nrps	Show	Open	Show	Scaffold Input	F * A * S * P	C(=O)N[C@H](C1CCCN1)N[C@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)N[C@H](CO)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](C1CCCN1)N[C@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)N[C@H](CO) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	3	1	nrps-pks	Show	Open	Show	Scaffold Input	A * T * horn * unknown	N[C@@H](C)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CCCNO)C(=O)C(*)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@@H](C)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CCCNO)C(=O)C() Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	28	2	nrps	Show	Open	Show	Scaffold Input	C * C * C * W	N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CS)C(=O)N[C@H](CS)C(=O)N[C@H](CS)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CS)C(=O)N[C@H](CS)C(=O)N[C@H](CS)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	22	1	nrps	Show	Open	Show	Scaffold Input	F * F * L * S	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	26	1	nrps	Show	Open	Show	Scaffold Input	horn * orn * F	C(=O)N[C@H](CCCNO)C(=O)N[C@H](CCCN)C(=O)N[C@H](Cc1ccccc1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](CCCNO)C(=O)N[C@H](CCCN)C(=O)N[C@H](Cc1ccccc1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	nrps	Show	Open	Show	Scaffold Input	orn * T * dhb	Oc1c(O)c(ccc1)C(=O)N[C@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	1	2	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	1	1	nrps	Show	Open	Show	Scaffold Input	dhb * F	Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1)	None
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure

Showing 1 to 10 of 34 entries

Previous1 2 3 4Next

Uploaded File: None

Record: NZ_CP032543.1

Comment: NZ_CP032543.1 Streptomyces griseus subsp. griseus strain ATCC 13273 chromosome, complete genome

Change record: 0