SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	22	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * dhb * malonyl	Oc1c(O)c(ccc1)C(=O)CC(O)CCC(C)C=C(C)C=CC=CC=CC=CC=CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CC(O)CC=CC(=O)CCCC(O)CC=CC(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)CC(O)CCC(C)C=C(C)C=CC=CC=CC=CC=CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CC(O)CC=CC(=O)CCCC(O)CC=CC(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	32	1	nrps-pks	Show	Open	Show	Scaffold Input	F * unknown * A * F * V * A * V * V * G * A * L * A * T * S * F * W * A * V * A * V * F * V	N[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C(C)C)N[C@H](Cc1ccccc1)C(=O)C(*)C(=O)N[C@H](C)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C(C)C)N[C@H](Cc1ccccc1)C(=O)C()C(=O)N[C@H](C)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)O Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	24	1	nrps-pks	Show	Open	Show	Scaffold Input	S * malonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * T * F * dhb * hpg * V * S	N[C@H](CO)C(=O)CC(=O)CC=C(C)C(O)C(C)CC(C)CC(C)C(O)CC(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:2 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CO)C(=O)CC(=O)CC=C(C)C(O)C(C)CC(C)CC(C)C(O)CC(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:2 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	25	1	pks-nrps	Show	Open	Show	Scaffold Input	unknown * unknown * S * T * unknown * unknown * unknown * G * unknown * G * unknown * unknown	C(O)C()C(=O)C()C(=O)N[C@H](CO)C(=O)N(C)[C@H](C(O)C)C=C()C=C()C=C()C(=O)NCC(O)C()(C)C(=O)NCC=C()C(O)C()	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(O)C()C(=O)C()C(=O)N[C@H](CO)C(=O)N(C)[C@H](C(O)C)C=C()C=C()C=C()C(=O)NCC(O)C()(C)C(=O)NCC=C()C(O)C() Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	16	1	nrps	Show	Open	Show	Scaffold Input	T * T * L * P * F * Y * V	C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](Cc1ccccc1)C(=O)N(C)[C@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(C)C)C(=O)O	None
Smiles C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](Cc1ccccc1)C(=O)N(C)[C@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(C)C)C(=O)O Postsynthetic modifications None Figure
	20	1	nrps	Show	Open	Show	Scaffold Input	L * V * N * T * A * F	N[C@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](CC(=O)N)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](C)C(=O)N[C@@H](Cc1ccccc1)	None
Smiles N[C@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](CC(=O)N)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](C)C(=O)N[C@@H](Cc1ccccc1) Postsynthetic modifications None Figure
	34	1	nrps	Show	Open	Show	Scaffold Input	dhb * T * T * T * T * P	N[C@H](C1CCCN1)Oc1c(O)c(ccc1)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(O)C)C(=O)O	Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C1CCCN1)Oc1c(O)c(ccc1)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(O)C)C(=O)O Postsynthetic modifications Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	37	1	nrps	Show	Open	Show	Scaffold Input	F * T * S * dhb * Y	N(C)[C@H](Cc1ccccc1)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N(C)[C@H](Cc1ccccc1)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	26	1	nrps-pks	Show	Open	Show	Scaffold Input	dhb * S * C * C * malonyl	Oc1c(O)c(ccc1)C(=O)N[C@H](CO)C(=O)N[C@H](CS)CCC(=O)N[C@H](CS)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](CO)C(=O)N[C@H](CS)CCC(=O)N[C@H](CS)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	9	2	nrps	Show	Open	Show	Scaffold Input	V * V * W * F * L	N[C@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)	None
Smiles N[C@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C) Postsynthetic modifications None Figure

Showing 1 to 10 of 52 entries

Previous1 2 3 4 5 6Next

Uploaded File: None

Record: NZ_CP029241.1

Comment: NZ_CP029241.1 Streptomyces sp. NHF165 chromosome, complete genome

Change record: 0