This site makes heavy use of Javascript.

In your browser, Javascript is either unsupported or deactivated. To make full use of this site, please either update your browser to a current version or activate Javascript. Also consider deactivating browser addons that can intefere with script execution for this site, such as NoScript for Firefox.

Uploaded File: None

Record: NC_021177.1

Comment: NC_021177.1 Streptomyces fulvissimus DSM 40593, complete sequence

Change record: 0

Genome browser

Open genome browser

Project

Download project folder

Debug

Download Log

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	3	4	nrps-pks	Show	Open	Show	Scaffold Input	G * unknown * unknown * methylmalonyl * malonyl * malonyl	C(C)C=CC(=O)CC(=O)NCC=C()C(=O)C()C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	25	1	pks	Show	Open	Show	Scaffold Input	malonyl * malonyl * malonyl * malonyl * malonyl	CC=CC=CC(O)CC=CCO	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:1 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:1 * 5-Ring:0 Figure
	16	2	nrps	Show	Open	Show	Scaffold Input	L * S * F * G	N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](CC(C)C)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	29	1	nrps	Show	Open	Show	Scaffold Input	F * F * F * S	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CO)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	5	1	nrps	Show	Open	Show	Scaffold Input	A * T * horn	N[C@@H](C)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CCCNO)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	4	1	nrps	Show	Open	Show	Scaffold Input	orn * T * dhb	Oc1c(O)c(ccc1)C(=O)N[C@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)O	None
Postsynthetic modifications None Figure
	6	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * L * unknown	CC(=O)N[C@H](CC(C)C)C(=O)C(*)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	1	1	nrps	Show	Open	Show	Scaffold Input	S * P	C(=O)N[C@H](CO)C(=O)N[C@H](C1CCCN1)C(=O)O	None
Postsynthetic modifications None Figure
	3	3	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	30	1	nrps-pks	Show	Open	Show	Scaffold Input	dhb * unknown	Oc1c(O)c(ccc1)C(=O)C(*)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 39 entries

Previous1 2 3 4Next