SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	30	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * F	CCC(=O)N[C@H](Cc1ccccc1)C=C(C)C(O)C(C)C=CC=C(C)C(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(=O)CC(O)C(C)CCC(O)C(C)C(O)CC(O)C(C)C=CC=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles CCC(=O)N[C@H](Cc1ccccc1)C=C(C)C(O)C(C)C=CC=C(C)C(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(=O)CC(O)C(C)CCC(O)C(C)C(O)CC(O)C(C)C=CC=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	38	2	pks	Show	Open	Show	Scaffold Input	malonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl	CC=C(C)CC(C)C=CCC(C)C=C(C)CCC=C(C)CC(C)C(O)C(C)C(O)CC(O)CC(O)CCC(C)C=C(C)C(O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:3 * Sphingo:0 * 5-Ring:3
Smiles CC=C(C)CC(C)C=CCC(C)C=C(C)CCC=C(C)CC(C)C(O)C(C)C(O)CC(O)CC(O)CCC(C)C=C(C)C(O)CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:3 * Sphingo:0 * 5-Ring:3 Figure
	34	1	nrps	Show	Open	Show	Scaffold Input	F * G * T * S * L * T * F * V * S * W * G * S * horn	N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNO)	None
Smiles N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNO) Postsynthetic modifications None Figure
	4	1	pks	Show	Open	Show	Scaffold Input	unknown * unknown * unknown * unknown * unknown * unknown * unknown * unknown * unknown * unknown * unknown * unknown * malonyl	C=C()C(=O)C()C(=O)C()C=C()C(=O)C()C(=O)C()C(=O)C()C=C()C=C()C=C()C(=O)C()C(=O)C()C(=O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C=C()C(=O)C()C(=O)C()C=C()C(=O)C()C(=O)C()C(=O)C()C=C()C=C()C=C()C(=O)C()C(=O)C()C(=O)CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	27	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl	C(C)C=C(C)C(O)C(C)C=CCCC(O)C(C)C(O)C(C)C(O)C(C)C(O)C(C)CCC(O)C(C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C=C(C)C(O)C(C)C=CCCC(O)C(C)C(O)C(C)C(O)C(C)C(O)C(C)CCC(O)C(C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	36	1	nrps-pks	Show	Open	Show	Scaffold Input	L * A * V * A * L * orn * T * orn * V * L * malonyl	N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C)CC(C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C)CC(C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	3	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl	C(C)C(O)C(C)C=CCC(C)C=CC(=O)C(C)C(=O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C(O)C(C)C=CCC(C)C=CC(=O)C(C)C(=O)CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	nrps-pks	Show	Open	Show	Scaffold Input	S * A * F * malonyl	C(=O)N[C@H](CO)C(=O)N[C@H](C)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)C	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](CO)C(=O)N[C@H](C)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)C Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	14	2	nrps	Show	Open	Show	Scaffold Input	F * F * dab	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CCN)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CCN)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	38	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl	C(C)C=C	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:3 * Sphingo:0 * 5-Ring:3
Smiles C(C)C=C Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:3 * Sphingo:0 * 5-Ring:3 Figure

Showing 1 to 10 of 42 entries

Previous1 2 3 4 5Next

Uploaded File: None

Record: NZ_CP054929.1

Comment: NZ_CP054929.1 Streptomyces sp. NA00687 chromosome, complete genome

Change record: 0 1