This site makes heavy use of Javascript.

In your browser, Javascript is either unsupported or deactivated. To make full use of this site, please either update your browser to a current version or activate Javascript. Also consider deactivating browser addons that can intefere with script execution for this site, such as NoScript for Firefox.

Uploaded File: None

Record: NZ_CP050177.1

Comment: NZ_CP050177.1 Streptomyces sp. QMT-12 chromosome, complete genome

Change record: 0

Genome browser

Open genome browser

Project

Download project folder

Debug

Download Log

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	23	1	nrps-pks	Show	Open	Show	Scaffold Input	G * unknown * malonyl * unknown * unknown * unknown * malonyl	NCC(=O)C()C=CC(=O)C()C(O)C()C(=O)C()C=CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	nrps	Show	Open	Show	Scaffold Input	V * S * V * S * V * F	C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CO)C(=O)N[C@H](C(C)C)C(=O)N[C@H](Cc1ccccc1)CO	None
Postsynthetic modifications None Figure
	5	3	nrps	Show	Open	Show	Scaffold Input	V * V * V * V * V * V	N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	27	1	nrps	Show	Open	Show	Scaffold Input	W * S * horn * horn * horn	N(C)[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CO)C(=O)N(C)[C@H](CCCNO)C(=O)N[C@H](CCCNO)C(=O)N[C@@H](CCCNO)	None
Postsynthetic modifications None Figure
	29	1	nrps	Show	Open	Show	Scaffold Input	S * N * F * F * P	C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C1CCCN1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	18	1	nrps	Show	Open	Show	Scaffold Input	A * G * N * A * dhb	C(=O)N[C@H](C)C(=O)NCC(=O)N[C@H](CC(=O)N)C(=O)N[C@H](C)C(=O)Oc1c(O)c(ccc1)	Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	12	1	nrps	Show	Open	Show	Scaffold Input	F * D * L	N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CC(=O)O)C(=O)O	None
Postsynthetic modifications None Figure
	5	1	nrps	Show	Open	Show	Scaffold Input	V * W * V	N[C@H](C(C)C)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](C(C)C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	15	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * orn	C=CC(=O)N[C@H](CCCN)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	20	1	nrps	Show	Open	Show	Scaffold Input	F * E	N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O)	None
Postsynthetic modifications None Figure

Showing 1 to 10 of 31 entries

Previous1 2 3 4Next