SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	39	1	pks	Show	Open	Show	Scaffold Input	malonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl	CC=CC(O)C(C)C(O)CC(O)C(C)C(O)C(C)C(O)C(C)C=C(C)CC(C)C(O)C(C)C(O)C(C)C=C(C)C=C(C)C(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC=CC(O)C(C)C(O)CC(O)C(C)C(O)C(C)C(O)C(C)C=C(C)CC(C)C(O)C(C)C(O)C(C)C=C(C)C=C(C)C(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	37	1	nrps-pks	Show	Open	Show	Scaffold Input	F * malonyl * methylmalonyl * malonyl * F	N[C@H](Cc1ccccc1)N[C@H](Cc1ccccc1)C(=O)CCC(C)CCC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)N[C@H](Cc1ccccc1)C(=O)CCC(C)CCC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	41	1	nrps	Show	Open	Show	Scaffold Input	W * S * horn * horn * horn	N(C)[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CO)C(=O)N(C)[C@H](CCCNO)C(=O)N[C@H](CCCNO)C(=O)N[C@@H](CCCNO)	None
Smiles N(C)[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CO)C(=O)N(C)[C@H](CCCNO)C(=O)N[C@H](CCCNO)C(=O)N[C@@H](CCCNO) Postsynthetic modifications None Figure
	4	1	nrps	Show	Open	Show	Scaffold Input	T * S * N * N	N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](CC(=O)N)CO	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](CC(=O)N)CO Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	nrps	Show	Open	Show	Scaffold Input	aad * F * C * C	N[C@H](CCCC(=O)O)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CS)C(=O)N[C@H](CS)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CCCC(=O)O)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CS)C(=O)N[C@H](CS)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	3	1	nrps	Show	Open	Show	Scaffold Input	dhb * L * F	Oc1c(O)c(ccc1)C(=O)N[C@H](CC(C)C)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](CC(C)C)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	40	1	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	27	1	nrps-pks	Show	Open	Show	Scaffold Input	F * malonyl	N[C@H](Cc1ccccc1)C	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	44	1	nrps	Show	Open	Show	Scaffold Input	D * dhb	N[C@H](CC(=O)O)C(=O)Oc1c(O)c(ccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC(=O)O)C(=O)Oc1c(O)c(ccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	15	1	nrps	Show	Open	Show	Scaffold Input	F * W	N(C)[C@H](Cc1ccccc1)C(=O)N(C)[C@H](CC1=CNC(=C12)C=CC=C2)	None
Smiles N(C)[C@H](Cc1ccccc1)C(=O)N(C)[C@H](CC1=CNC(=C12)C=CC=C2) Postsynthetic modifications None Figure

Showing 1 to 10 of 48 entries

Previous1 2 3 4 5Next

Uploaded File: None

Record: NC_013929.1

Comment: NC_013929.1 Streptomyces scabiei 87.22, complete genome

Change record: 0