SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	29	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl	C(C)C(O)C(C)C(O)CC(=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)CC(C)C=C(C)C=C(C)C=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C(O)C(C)C(O)CC(=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)CC(C)C=C(C)C=C(C)C=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	13	1	nrps	Show	Open	Show	Scaffold Input	A * A * T * T * T * aad * T * F * V	N[C@H](C)C(=O)N[C@H](C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](C(C)C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C)C(=O)N[C@H](C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](C(C)C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	6	1	nrps	Show	Open	Show	Scaffold Input	F * G * L	N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](CC(C)C)CO	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](CC(C)C)CO Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	15	1	nrps	Show	Open	Show	Scaffold Input	aad * C * V	N[C@H](CCCC(=O)O)C(=O)N[C@H](CS)C(=O)N[C@@H](C(C)C)C(=O)O	None
Smiles N[C@H](CCCC(=O)O)C(=O)N[C@H](CS)C(=O)N[C@@H](C(C)C)C(=O)O Postsynthetic modifications None Figure
	10	1	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * orn	C=CC(=O)N[C@H](CCCN)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C=CC(=O)N[C@H](CCCN)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	8	1	nrps	Show	Open	Show	Scaffold Input	V * P	N[C@H](C(C)C)C(=O)N[C@H](C1CCCN1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C(C)C)C(=O)N[C@H](C1CCCN1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	20	1	nrps	Show	Open	Show	Scaffold Input	S * P	C(=O)N[C@H](CO)C(=O)N[C@H](C1CCCN1)C(=O)O	None
Smiles C(=O)N[C@H](CO)C(=O)N[C@H](C1CCCN1)C(=O)O Postsynthetic modifications None Figure
	14	1	nrps	Show	Open	Show	Scaffold Input	S * P	C(=O)N[C@H](CO)C(=O)N[C@H](C1CCCN1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](CO)C(=O)N[C@H](C1CCCN1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	5	1	nrps	Show	Open	Show	Scaffold Input	V * F	N(C)[C@H](C(C)C)C(=O)N[C@H](Cc1ccccc1)CO	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N(C)[C@H](C(C)C)C(=O)N[C@H](Cc1ccccc1)CO Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 33 entries

Previous1 2 3 4Next

Uploaded File: None

Record: NZ_CP032052.1

Comment: NZ_CP032052.1 Streptomyces clavuligerus strain F1D-5 chromosome, complete genome

Change record: 0 1 2