SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	29	2	pks	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl	C(C)C(O)C(C)C(O)CC(=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)CC(C)C(O)C(C)C=C(C)C=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C(O)C(C)C(O)CC(=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)CC(C)C(O)C(C)C=C(C)C=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	3	nrps-pks	Show	Open	Show	Scaffold Input	G * unknown * unknown * methylmalonyl * malonyl * malonyl	C(C)C=CC(=O)CC(=O)NCC=C()C(=O)C()C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C=CC(=O)CC(=O)NCC=C()C(=O)C()C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	31	1	nrps	Show	Open	Show	Scaffold Input	G * F * S * A * S * V	C(=O)NCC(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CO)C(=O)N[C@H](C)C(=O)N[C@H](CO)C(=O)N[C@H](C(C)C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)NCC(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CO)C(=O)N[C@H](C)C(=O)N[C@H](CO)C(=O)N[C@H](C(C)C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	14	2	nrps	Show	Open	Show	Scaffold Input	aad * F * S * F * G	N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	26	1	nrps	Show	Open	Show	Scaffold Input	F * F * F * S	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CO)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CO) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	29	1	nrps	Show	Open	Show	Scaffold Input	dhb * F * L	Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1)N[C@H](CC(C)C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1)N[C@H](CC(C)C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	3	1	nrps	Show	Open	Show	Scaffold Input	orn * T * dhb	Oc1c(O)c(ccc1)C(=O)N[C@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)O	None
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)O Postsynthetic modifications None Figure
	4	1	nrps	Show	Open	Show	Scaffold Input	S * T * horn	N[C@@H](CO)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CCCNO)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@@H](CO)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CCCNO) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	2	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	nrps	Show	Open	Show	Scaffold Input	dhb * F	Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 40 entries

Previous1 2 3 4Next

Uploaded File: None

Record: NZ_CP024957.1

Comment: NZ_CP024957.1 Streptomyces cavourensis strain 1AS2a chromosome, complete genome

Change record: 0