SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	26	1	nrps	Show	Open	Show	Scaffold Input	D * dhb * pip * D * D * G * D * G * dab * V * P * A * P	C(=O)N[C@H](C)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](CC(=O)O)C(=O)Oc1c(O)c(ccc1)C(=O)N1[C@@H](CCC1)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)N[C@@H](CCN)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C1CCCN1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](C)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](CC(=O)O)C(=O)Oc1c(O)c(ccc1)C(=O)N1[C@@H](CCC1)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)N[C@@H](CCN)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C1CCCN1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	nrps-pks	Show	Open	Show	Scaffold Input	F * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * T * F * hpg * V * S	N[C@H](Cc1ccccc1)C(=O)CC=C(C)C(O)C(C)CC(C)CC(C)C(O)CC(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:2 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)CC=C(C)C(O)C(C)CC(C)CC(C)C(O)CC(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:2 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	1	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl	C(C)C=C(C)C=C(C)C=C(C)C=CC=C(C)C=CC=CC=C(C)C(O)CCC(C)C=C(C)	Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C=C(C)C=C(C)C=C(C)C=CC=C(C)C=CC=CC=C(C)C(O)CCC(C)C=C(C) Postsynthetic modifications Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	39	1	pks	Show	Open	Show	Scaffold Input	malonyl * methylmalonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * malonyl	CC=CC(O)C(C)C(=O)CC=C(C)C=CC(O)CCCC=C(C)C(=O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC=CC(O)C(C)C(=O)CC=C(C)C=CC(O)CCCC=C(C)C(=O)CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	37	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * malonyl * ethylmalonyl * malonyl * methylmalonyl * methylmalonyl * malonyl	C(O)C(C)C(=O)CC(O)CCC(CC)C=CCC(C)C(=O)C(C)C=C	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(O)C(C)C(=O)CC(O)CCC(CC)C=CCC(C)C(=O)C(C)C=C Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	32	1	pks-nrps	Show	Open	Show	Scaffold Input	unknown * F * F	N[C@H](Cc1ccccc1)C(=O)C(*)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)C()C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	27	1	nrps	Show	Open	Show	Scaffold Input	F * orn * horn	C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CCCN)C(=O)N[C@H](CCCNO)C(=O)O	None
Smiles C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CCCN)C(=O)N[C@H](CCCNO)C(=O)O Postsynthetic modifications None Figure
	36	1	nrps	Show	Open	Show	Scaffold Input	dhb * C * C	Oc1c(O)c(ccc1)C(=O)N[C@H](CS)C(=O)N[C@H](CS)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](CS)C(=O)N[C@H](CS)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	9	2	nrps-pks	Show	Open	Show	Scaffold Input	V * P * unknown	N[C@H](C(C)C)C(=O)N[C@H](C1CCCN1)C(O)C(*)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C(C)C)C(=O)N[C@H](C1CCCN1)C(O)C()C(=O)O Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	38	1	nrps	Show	Open	Show	Scaffold Input	S * T * horn	N[C@@H](CO)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CCCNO)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@@H](CO)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CCCNO) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 43 entries

Previous1 2 3 4 5Next

Uploaded File: None

Record: NZ_CP036534.1

Comment: NZ_CP036534.1 Streptomyces sp. VN1 chromosome, complete genome

Change record: 0