This site makes heavy use of Javascript.

In your browser, Javascript is either unsupported or deactivated. To make full use of this site, please either update your browser to a current version or activate Javascript. Also consider deactivating browser addons that can intefere with script execution for this site, such as NoScript for Firefox.

Uploaded File: None

Record: NZ_CP007699.2

Comment: NZ_CP007699.2 Streptomyces lydicus strain A02 chromosome, complete genome

Change record: 0

Genome browser

Open genome browser

Project

Download project folder

Debug

Download Log

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	38	2	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * malonyl * malonyl * F * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl	N[C@H](Cc1ccccc1)C(=O)CC(O)CC=CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CC(O)CC=CC=CC(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)CC(O)CC=CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CC(O)CC=CC=CC(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	pks	Show	Open	Show	Scaffold Input	unknown * unknown * unknown * unknown * unknown * unknown * unknown * unknown * unknown * unknown	C=C()C(=O)C()C(O)C()C(=O)C()C=C()C(O)C()(C)C(=O)C()C=C()C(=O)C()C=C()C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C=C()C(=O)C()C(O)C()C(=O)C()C=C()C(O)C()(C)C(=O)C()C=C()C(=O)C()C=C()C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	29	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * F	N[C@H](Cc1ccccc1)CCC(O)C(C)C=CC=CC=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)CCC(O)C(C)C=CC=CC=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	37	1	nrps	Show	Open	Show	Scaffold Input	V * A * G * P * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)NCC(=O)N[C@H](C1CCCN1)C(=O)N[C@H](C(C)C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)NCC(=O)N[C@H](C1CCCN1)C(=O)N[C@H](C(C)C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	10	1	nrps-pks	Show	Open	Show	Scaffold Input	S * unknown * G * P * G	NCC(=O)N[C@H](CO)C(=O)C(*)C(=O)NCC(=O)N[C@H](C1CCCN1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles NCC(=O)N[C@H](CO)C(=O)C()C(=O)NCC(=O)N[C@H](C1CCCN1) Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	9	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * C	C(C)C(=O)CC(=O)N[C@H](CS)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C(=O)CC(=O)N[C@H](CS)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	13	1	nrps	Show	Open	Show	Scaffold Input	S * P	C(=O)N[C@H](CO)C(=O)N[C@H](C1CCCN1)C(=O)O	None
Smiles C(=O)N[C@H](CO)C(=O)N[C@H](C1CCCN1)C(=O)O Postsynthetic modifications None Figure
	25	1	nrps	Show	Open	Show	Scaffold Input	F * E	N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	23	1	nrps	Show	Open	Show	Scaffold Input	F * E	N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	36	1	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure

Showing 1 to 10 of 44 entries

Previous1 2 3 4 5Next