This site makes heavy use of Javascript.

In your browser, Javascript is either unsupported or deactivated. To make full use of this site, please either update your browser to a current version or activate Javascript. Also consider deactivating browser addons that can intefere with script execution for this site, such as NoScript for Firefox.

Uploaded File: None

Record: NZ_CP025511.1

Comment: NZ_CP025511.1 Streptomyces sp. DUT11 chromosome

Change record: 0

Genome browser

Open genome browser

Project

Download project folder

Debug

Download Log

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	2	4	nrps-pks	Show	Open	Show	Scaffold Input	G * unknown * unknown * methylmalonyl * malonyl * malonyl	C(C)C=CC(=O)CC(=O)NCC=C()C(=O)C()C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C=CC(=O)CC(=O)NCC=C()C(=O)C()C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	26	1	nrps	Show	Open	Show	Scaffold Input	F * F * L * aad * C	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](CS)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](CS) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	16	2	nrps	Show	Open	Show	Scaffold Input	L * S * F * D * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	3	nrps	Show	Open	Show	Scaffold Input	F * dhb * dhb * F	N[C@H](Cc1ccccc1)C(=O)Oc1c(O)c(ccc1)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)Oc1c(O)c(ccc1)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	4	1	nrps	Show	Open	Show	Scaffold Input	S * T * dhb * horn	N[C@@H](CO)C(=O)N[C@H](C(O)C)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](CCCNO)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@@H](CO)C(=O)N[C@H](C(O)C)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](CCCNO) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	3	1	nrps	Show	Open	Show	Scaffold Input	dhb * T * dhb	Oc1c(O)c(ccc1)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](C(O)C)C(=O)O	None
Smiles Oc1c(O)c(ccc1)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](C(O)C)C(=O)O Postsynthetic modifications None Figure
	21	1	nrps	Show	Open	Show	Scaffold Input	aad * E	N[C@H](CCCC(=O)O)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](CCCC(=O)O)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	33	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * A	C(O)CC(=O)N[C@H](C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(O)CC(=O)N[C@H](C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	23	1	nrps	Show	Open	Show	Scaffold Input	aad * E	N[C@H](CCCC(=O)O)C(=O)N[C@H](CCC(=O)O)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CCCC(=O)O)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	27	1	nrps	Show	Open	Show	Scaffold Input	A * E	N[C@H](C)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](C)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure

Showing 1 to 10 of 41 entries

Previous1 2 3 4 5Next