This site makes heavy use of Javascript.

In your browser, Javascript is either unsupported or deactivated. To make full use of this site, please either update your browser to a current version or activate Javascript. Also consider deactivating browser addons that can intefere with script execution for this site, such as NoScript for Firefox.

Uploaded File: None

Record: NZ_CP053109.1

Comment: NZ_CP053109.1 Streptomyces sp. Z423-1 chromosome

Change record: 0

Genome browser

Open genome browser

Project

Download project folder

Debug

Download Log

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	1	1	pks	Show	Open	Show	Scaffold Input	malonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * malonyl	CC(O)C(C)C(O)CC=C(C)C(O)C(C)C=C(C)C=CC(=O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC(O)C(C)C(O)CC=C(C)C(O)C(C)C=C(C)C=CC(=O)CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	28	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * W * S * horn * horn * horn * dhb	Oc1c(O)c(ccc1)C(=O)CC(=O)N(C)[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CO)C(=O)N(C)[C@H](CCCNO)C(=O)N[C@H](CCCNO)C(=O)N[C@@H](CCCNO)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)CC(=O)N(C)[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CO)C(=O)N(C)[C@H](CCCNO)C(=O)N[C@H](CCCNO)C(=O)N[C@@H](CCCNO) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	7	1	nrps	Show	Open	Show	Scaffold Input	W * G * C * V	N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)NCC(=O)N(C)[C@H](CS)C(=O)N(C)[C@H](C(C)C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)NCC(=O)N(C)[C@H](CS)C(=O)N(C)[C@H](C(C)C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	30	1	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	9	1	nrps-pks	Show	Open	Show	Scaffold Input	F * methylmalonyl	N[C@H](Cc1ccccc1)C=C(C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C=C(C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	19	1	nrps	Show	Open	Show	Scaffold Input	F * E	N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	7	2	nrps	Show	Open	Show	Scaffold Input	dhb * C	Oc1c(O)c(ccc1)C(=O)N[C@H](CS)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](CS) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	12	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * C	C(C)C(=O)N[C@H](CS)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C(=O)N[C@H](CS)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	3	1	nrps	Show	Open	Show	Scaffold Input	F * E	N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	11	1	nrps	Show	Open	Show	Scaffold Input	F	N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure

Showing 1 to 10 of 37 entries

Previous1 2 3 4Next