This site makes heavy use of Javascript.

In your browser, Javascript is either unsupported or deactivated. To make full use of this site, please either update your browser to a current version or activate Javascript. Also consider deactivating browser addons that can intefere with script execution for this site, such as NoScript for Firefox.

Uploaded File: None

Record: NZ_CP050975.1

Comment: NZ_CP050975.1 Streptomyces sp. RPA4-2 chromosome, complete genome

Change record: 0

Genome browser

Open genome browser

Project

Download project folder

Debug

Download Log

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	1	2	pks	Show	Open	Show	Scaffold Input	malonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl	C(O)C(C)C(O)C(C)C(O)C(C)C(O)C(C)C(O)CC(O)CC(O)CC(=O)C	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles C(O)C(C)C(O)C(C)C(O)C(C)C(O)C(C)C(O)CC(O)CC(O)CC(=O)C Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	18	1	nrps	Show	Open	Show	Scaffold Input	F * L * aad * aad * F * C	C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CS)	None
Smiles C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CS) Postsynthetic modifications None Figure
	2	1	nrps-pks	Show	Open	Show	Scaffold Input	I * dhb * malonyl	N[C@H](C(C)CC)C(=O)Oc1c(O)c(ccc1)C	Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:2 * 5-Ring:1
Smiles N[C@H](C(C)CC)C(=O)Oc1c(O)c(ccc1)C Postsynthetic modifications Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:2 * 5-Ring:1 Figure
	24	1	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	3	nrps	Show	Open	Show	Scaffold Input	aad * dhb	N[C@H](CCCC(=O)O)C(=O)Oc1c(O)c(ccc1)	Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:2 * 5-Ring:1
Smiles N[C@H](CCCC(=O)O)C(=O)Oc1c(O)c(ccc1) Postsynthetic modifications Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:2 * 5-Ring:1 Figure
	5	1	nrps-pks	Show	Open	Show	Scaffold Input	dhb * methylmalonyl	Oc1c(O)c(ccc1)C(=O)C(C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)C(C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	3	1	nrps	Show	Open	Show	Scaffold Input	dhb * F	Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	4	1	nrps	Show	Open	Show	Scaffold Input	aad * F	C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	11	1	nrps	Show	Open	Show	Scaffold Input	F * E	N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	3	2	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 36 entries

Previous1 2 3 4Next