SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	26	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * dhb * malonyl	Oc1c(O)c(ccc1)C(=O)CC(O)C(C)CC(C)C=C(C)C=CC=CC=CC=CC=CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CC(O)CCCCCC(O)CCCC=CC(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)CC(O)C(C)CC(C)C=C(C)C=CC=CC=CC=CC=CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CC(O)CCCCCC(O)CCCC=CC(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	16	1	nrps	Show	Open	Show	Scaffold Input	V * A * V * V * W * W * L * V * T * A * L * V * A * V * A * V * F * L	N[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)	None
Smiles N[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C) Postsynthetic modifications None Figure
	28	1	nrps-pks	Show	Open	Show	Scaffold Input	G * unknown * malonyl * unknown * unknown * unknown * malonyl	NCC(=O)C()C=CC(=O)C()C(O)C()C(=O)C()C=CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles NCC(=O)C()C=CC(=O)C()C(O)C()C(=O)C()C=CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	8	1	nrps	Show	Open	Show	Scaffold Input	F * L * V * F * T * T	C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](C(O)C)	None
Smiles C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](C(O)C) Postsynthetic modifications None Figure
	1	1	pks-nrps	Show	Open	Show	Scaffold Input	unknown * malonyl * T * V	C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(C)C)C(=O)C(*)C=CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(C)C)C(=O)C()C=CC(=O)O Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	27	1	nrps-pks	Show	Open	Show	Scaffold Input	F * malonyl * malonyl * P	N[C@H](Cc1ccccc1)CC(=O)N[C@H](C1CCCN1)C(=O)C	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)CC(=O)N[C@H](C1CCCN1)C(=O)C Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	15	1	nrps	Show	Open	Show	Scaffold Input	orn * orn * horn	C(=O)N[C@H](CCCN)C(=O)N[C@H](CCCN)C(=O)N[C@H](CCCNO)C(=O)O	None
Smiles C(=O)N[C@H](CCCN)C(=O)N[C@H](CCCN)C(=O)N[C@H](CCCNO)C(=O)O Postsynthetic modifications None Figure
	11	1	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	19	1	nrps	Show	Open	Show	Scaffold Input	A * E	N[C@H](C)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](C)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	2	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * orn	C=CC(=O)N[C@H](CCCN)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C=CC(=O)N[C@H](CCCN)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 28 entries

Previous1 2 3Next

Uploaded File: None

Record: NC_020990.1

Comment: NC_020990.1 Streptomyces albidoflavus, complete sequence

Change record: 0