SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	45	1	nrps-pks	Show	Open	Show	Scaffold Input	pip * malonyl * methylmalonyl * methylmalonyl * malonyl * ethylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * malonyl * ethylmalonyl * malonyl * methylmalonyl * methylmalonyl * malonyl	C(=O)N1[C@H](CCC1)C(=O)CC(O)C(C)C=C(C)C(=O)CC=C(CC)C(O)C(C)CC(C)C=C(C)C(O)CC(=O)CC(O)C(C)C(O)CC(O)CCC(C)C=CC=C(C)C(=O)CC(O)CCC(CC)C=CCC(C)C(=O)C(C)C=C	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N1[C@H](CCC1)C(=O)CC(O)C(C)C=C(C)C(=O)CC=C(CC)C(O)C(C)CC(C)C=C(C)C(O)CC(=O)CC(O)C(C)C(O)CC(O)CCC(C)C=CC=C(C)C(=O)CC(O)CCC(CC)C=CCC(C)C(=O)C(C)C=C Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	33	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * dhb	Oc1c(O)c(ccc1)C(O)CC(O)CC(O)CC(O)CC=CC(O)CC=CC(O)CC=CC(O)C(C)C(O)CC=CC=CC=CC=CC(O)C(C)C(O)C(C)C=CCCC=CC(=O)CC=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(O)CC(O)CC(O)CC(O)CC=CC(O)CC=CC(O)CC=CC(O)C(C)C(O)CC=CC=CC=CC=CC(O)C(C)C(O)C(C)C=CCCC=CC(=O)CC=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	10	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * F	CCC(=O)N[C@H](Cc1ccccc1)C=C(C)C(O)C(C)C=CC=C(C)C(O)CC(O)CC(O)CC(O)CC(O)CC(=O)CC(O)C(C)CCC(O)C(C)C(O)CC(O)C(C)C=CC=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles CCC(=O)N[C@H](Cc1ccccc1)C=C(C)C(O)C(C)C=CC=C(C)C(O)CC(O)CC(O)CC(O)CC(O)CC(=O)CC(O)C(C)CCC(O)C(C)C(O)CC(O)C(C)C=CC=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	39	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * ethylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * L * E * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl	N[C@H](CC(C)C)C(=O)N[C@H](CCC(=O)O)C=C(C)C(=O)CC(O)C(CC)CC(C)CC(C)C=C(C)C=C(C)C=C(C)CCCC(C)C=C(C)C=C(C)C=CC(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC(C)C)C(=O)N[C@H](CCC(=O)O)C=C(C)C(=O)CC(O)C(CC)CC(C)CC(C)C=C(C)C=C(C)C=C(C)CCCC(C)C=C(C)C=C(C)C=CC(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	11	2	pks	Show	Open	Show	Scaffold Input	malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * unknown * malonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl	CC(=O)C(C)CC(C)C=CCC(C)C=C(C)CCC=C(C)C(O)C(C)C(O)CC(O)CC(O)CCC(C)C=C(C)C(O)C(*)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:3 * Sphingo:0 * 5-Ring:3
Smiles CC(=O)C(C)CC(C)C=CCC(C)C=C(C)CCC=C(C)C(O)C(C)C(O)CC(O)CC(O)CCC(C)C=C(C)C(O)C() Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:3 * Sphingo:0 * 5-Ring:3 Figure
	47	2	pks	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * methylmalonyl	C(C)C(O)CC(=O)C(C)CC(C)C(O)C(C)C(O)CC=C(C)C(O)CC=C(C)C=CC=C(C)C=CC=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C(O)CC(=O)C(C)CC(C)C(O)C(C)C(O)CC=C(C)C(O)CC=C(C)C=CC=C(C)C=CC=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	nrps-pks	Show	Open	Show	Scaffold Input	P * F * methylmalonyl * malonyl * malonyl * malonyl * pip * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl	C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](Cc1ccccc1)C(=O)N1[C@H](CCC1)CC(C)C=C(C)C=CCC(C)C(=O)CCC(C)C=CC=CC=C	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](Cc1ccccc1)C(=O)N1[C@H](CCC1)CC(C)C=C(C)C=CCC(C)C(=O)CCC(C)C=CC=CC=C Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	9	1	nrps	Show	Open	Show	Scaffold Input	D * D * dhb * pip * G * D * G * D * G * T * V * P	N[C@H](CC(=O)O)C(=O)N[C@H](CC(=O)O)C(=O)Oc1c(O)c(ccc1)C(=O)N1[C@@H](CCC1)C(=O)NCC(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)N[C@@H](C(O)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C1CCCN1)C(=O)O	None
Smiles N[C@H](CC(=O)O)C(=O)N[C@H](CC(=O)O)C(=O)Oc1c(O)c(ccc1)C(=O)N1[C@@H](CCC1)C(=O)NCC(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)N[C@@H](C(O)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C1CCCN1)C(=O)O Postsynthetic modifications None Figure
	7	1	nrps-pks	Show	Open	Show	Scaffold Input	T * F * dhb * hpg * V * S * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl	CC=C(C)C(O)C(C)CC(C)CC(C)C(O)CC(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:2 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC=C(C)C(O)C(C)CC(C)CC(C)C(O)CC(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:2 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	16	2	nrps	Show	Open	Show	Scaffold Input	D * D * dhb * G * dhb * dhb * D * G * F * G * P	N[C@H](CC(=O)O)C(=O)N[C@H](CC(=O)O)C(=O)Oc1c(O)c(ccc1)C(=O)NCC(=O)Oc1c(O)c(ccc1)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](C1CCCN1)C(=O)O	Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC(=O)O)C(=O)N[C@H](CC(=O)O)C(=O)Oc1c(O)c(ccc1)C(=O)NCC(=O)Oc1c(O)c(ccc1)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](C1CCCN1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 63 entries

Previous1 2 3 4 5 6 7Next

Uploaded File: None

Record: NZ_CP029823.1

Comment: NZ_CP029823.1 Streptomyces malaysiensis strain DSM 4137 chromosome, complete genome

Change record: 0