This site makes heavy use of Javascript.

In your browser, Javascript is either unsupported or deactivated. To make full use of this site, please either update your browser to a current version or activate Javascript. Also consider deactivating browser addons that can intefere with script execution for this site, such as NoScript for Firefox.

Uploaded File: None

Record: NZ_CP020555.1

Comment: NZ_CP020555.1 Streptomyces sp. Sge12 chromosome, complete genome

Change record: 0 1

Genome browser

Open genome browser

Project

Download project folder

Debug

Download Log

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	7	1	nrps	Show	Open	Show	Scaffold Input	W * S * V * A * G * V * F * L	C(=O)N[C@H](C(C)C)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CO)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C)C(=O)NCC(=O)O	None
Postsynthetic modifications None Figure
	17	2	nrps	Show	Open	Show	Scaffold Input	F * A * A * V * A * F	N[C@@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)N[C@@H](C)C(=O)N(C)[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](Cc1ccccc1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	17	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * I	C(=O)N[C@H](C(C)CC)C(=O)C(C)C=C(C)C=CC=CCCC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	33	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * A * T * horn	N[C@@H](C)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CCCNO)C(=O)C	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	nrps	Show	Open	Show	Scaffold Input	F * L * V	C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C(C)C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	34	1	nrps	Show	Open	Show	Scaffold Input	F * L * S	N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	32	1	nrps	Show	Open	Show	Scaffold Input	C * F * F	C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](CS)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	7	2	nrps	Show	Open	Show	Scaffold Input	T * S	C(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)O	None
Postsynthetic modifications None Figure
	6	1	nrps	Show	Open	Show	Scaffold Input	V * S	C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)	None
Postsynthetic modifications None Figure
	9	1	pks	Show	Open	Show	Scaffold Input	malonyl * malonyl	C(=O)CC(=O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 44 entries

Previous1 2 3 4 5Next