SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	1	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * methylmalonyl * malonyl * malonyl * unknown * malonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * dhb * malonyl * T * dhb * dhb * malonyl * F	N[C@H](Cc1ccccc1)Oc1c(O)c(ccc1)C(=O)CC(=O)N[C@H](C(O)C)C(=O)Oc1c(O)c(ccc1)C(=O)Oc1c(O)c(ccc1)C(=O)CCC(C)C(=O)C(C)C=CC=CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CCC(*)CCC(O)CCCC(=O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)Oc1c(O)c(ccc1)C(=O)CC(=O)N[C@H](C(O)C)C(=O)Oc1c(O)c(ccc1)C(=O)Oc1c(O)c(ccc1)C(=O)CCC(C)C(=O)C(C)C=CC=CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CCC()CCC(O)CCCC(=O)CC(=O)O Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	6	1	nrps	Show	Open	Show	Scaffold Input	S * aad * W * D * D * hpg * D * G * D * E * dhb * W	C(=O)N[C@H](CO)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)N[C@H](CC(=O)O)C(=O)N[C@H](CCC(=O)O)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](CO)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@H](CC(=O)O)C(=O)NCC(=O)N[C@H](CC(=O)O)C(=O)N[C@H](CCC(=O)O)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * A	N[C@H](C)C=CC(=O)CC=CC=CC=CC=CC(=O)O	Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C)C=CC(=O)CC=CC=CC=CC=CC(=O)O Postsynthetic modifications Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	22	1	nrps	Show	Open	Show	Scaffold Input	aad * E	N[C@H](CCCC(=O)O)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](CCCC(=O)O)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	16	1	nrps	Show	Open	Show	Scaffold Input	L * dhb	N[C@H](CC(C)C)C(=O)Oc1c(O)c(ccc1)	None
Smiles N[C@H](CC(C)C)C(=O)Oc1c(O)c(ccc1) Postsynthetic modifications None Figure
	7	1	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	3	1	nrps	Show	Open	Show	Scaffold Input	F * dhb	N[C@H](Cc1ccccc1)C(=O)Oc1c(O)c(ccc1)	None
Smiles N[C@H](Cc1ccccc1)C(=O)Oc1c(O)c(ccc1) Postsynthetic modifications None Figure
	12	1	nrps	Show	Open	Show	Scaffold Input	E * dhb	N[C@H](CCC(=O)O)C(=O)Oc1c(O)c(ccc1)	None
Smiles N[C@H](CCC(=O)O)C(=O)Oc1c(O)c(ccc1) Postsynthetic modifications None Figure
	13	1	nrps	Show	Open	Show	Scaffold Input	aad * F	N[C@H](CCCC(=O)O)C(=O)N[C@H](Cc1ccccc1)	None
Smiles N[C@H](CCCC(=O)O)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	17	1	nrps	Show	Open	Show	Scaffold Input	dhb	Oc1c(O)c(ccc1)	None
Smiles Oc1c(O)c(ccc1) Postsynthetic modifications None Figure

Showing 1 to 10 of 26 entries

Previous1 2 3Next

Uploaded File: None

Record: NZ_CP042278.1

Comment: NZ_CP042278.1 Streptomyces sp. WAC6273 substr. delta orf15 pCRISPR-Cas9 chromosome, complete gen...

Change record: 0