SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	2	1	nrps	Show	Open	Show	Scaffold Input	S * F * V * S * F * V * V * Y * S * V * V * V * hpg * V * Y * hpg * hpg	C(=O)N[C@H](CO)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CO)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](C(C)C)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](CO)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CO)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](C(C)C)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	44	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * A * F * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * F	N[C@H](Cc1ccccc1)CC(=O)N[C@H](C)C(=O)N[C@H](Cc1ccccc1)C=CC=CC=C(C)C=CC=CC(O)CC=CC=C(C)C=CC(=O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)CC(=O)N[C@H](C)C(=O)N[C@H](Cc1ccccc1)C=CC=CC=C(C)C=CC=CC(O)CC=CC=C(C)C=CC(=O)CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	49	1	nrps-pks	Show	Open	Show	Scaffold Input	N * H * A * malonyl * T * S * N * A * C * S * malonyl * T * S	CC(=O)N[C@H](CC(=O)N)C(=O)N[C@H](CC1=CNC=N1)C(=O)N[C@H](C)C(O)C(C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](C)C(=O)N[C@H](CS)C(=O)N[C@H](CO)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)O	Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC(=O)N[C@H](CC(=O)N)C(=O)N[C@H](CC1=CNC=N1)C(=O)N[C@H](C)C(O)C(C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](C)C(=O)N[C@H](CS)C(=O)N[C@H](CO)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	39	2	pks	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl	C(C)C=CCC(C)C=CC=CC=CC=C(C)CCC=C(C)C=C(C)C(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C=CCC(C)C=CC=CC=CC=C(C)CCC=C(C)C=C(C)C(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	10	1	nrps	Show	Open	Show	Scaffold Input	L * A * V * A * L * orn * T * orn * V * L	N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C)	None
Smiles N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C) Postsynthetic modifications None Figure
	8	1	pks	Show	Open	Show	Scaffold Input	malonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * malonyl	CC=C(C)C(O)CC(O)C(C)C(O)C(C)C(O)C(C)C=CC=CC(=O)O	Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC=C(C)C(O)CC(O)C(C)C(O)C(C)C(O)C(C)C=CC=CC(=O)O Postsynthetic modifications Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	25	1	nrps	Show	Open	Show	Scaffold Input	N * L * D * W * T * L * V * F	N[C@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C(C)C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C(C)C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	42	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * G * unknown	NCC(=O)C(*)C(C)C(O)C(C)CCC=CC=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles NCC(=O)C()C(C)C(O)C(C)CCC=CC=C(C)C(=O)O Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	1	1	nrps	Show	Open	Show	Scaffold Input	S * F * F * P * S * S	C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C1CCCN1)C(=O)O	Glyco:0 * NO2:0 * Cl:2 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C1CCCN1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:2 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	1	2	nrps	Show	Open	Show	Scaffold Input	S * S * S * P	N[C@H](C1CCCN1)C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:2 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C1CCCN1)C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:2 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 59 entries

Previous1 2 3 4 5 6Next

Uploaded File: None

Record: NZ_CP054916.1

Comment: NZ_CP054916.1 Streptomyces sp. NA02950 chromosome, complete genome

Change record: 0 1