SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	3	1	pks	Show	Open	Show	Scaffold Input	malonyl * ethylmalonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * ethylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * ethylmalonyl	CC=C(CC)CCC=C(C)CCC(=O)CC(O)CC(O)C(C)CC(C)C(O)C(CC)C(=O)C(C)C(O)C(C)C(O)C(C)CCC(O)C(CC)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:2 * 5-Ring:1
Smiles CC=C(CC)CCC=C(C)CCC(=O)CC(O)CC(O)C(C)CC(C)C(O)C(CC)C(=O)C(C)C(O)C(C)C(O)C(C)CCC(O)C(CC) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:2 * 5-Ring:1 Figure
	9	2	pks	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl	C(C)C(O)C(C)C(O)C(C)C(O)C(C)C(O)C(C)C=CC(O)CC(O)CC(=O)CCCC=CC(O)CC(O)C(C)C=CC(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles C(C)C(O)C(C)C(O)C(C)C(O)C(C)C(O)C(C)C=CC(O)CC(O)CC(=O)CCCC=CC(O)CC(O)C(C)C=CC(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	2	1	nrps	Show	Open	Show	Scaffold Input	G * G * T * S * L * T * F * V * S * F * G * S * horn	C(=O)NCC(=O)NCC(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNO)C(=O)O	None
Smiles C(=O)NCC(=O)NCC(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNO)C(=O)O Postsynthetic modifications None Figure
	13	1	pks	Show	Open	Show	Scaffold Input	malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl	C(=O)CC=C(C)C(O)C(C)C=C(C)C=CCC(C)C=CC(O)C(C)C(O)C(C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)CC=C(C)C(O)C(C)C=C(C)C=CCC(C)C=CC(O)C(C)C(O)C(C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	11	1	pks	Show	Open	Show	Scaffold Input	malonyl * malonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl	C=C(C)C=CC=CC(=O)CC(O)C(C)C(O)CC=CC=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C=C(C)C=CC=CC(=O)CC(O)C(C)C(O)CC=CC=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	39	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * T * L * Y * S * A	C(=O)C(C)C(=O)CC(=O)N(C)[C@H](C(O)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)N(C)[C@H](CO)C(=O)N[C@H](C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)C(C)C(=O)CC(=O)N(C)[C@H](C(O)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)N(C)[C@H](CO)C(=O)N[C@H](C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	15	1	nrps	Show	Open	Show	Scaffold Input	L * T * V * V * P * F * V	C(=O)N(C)[C@H](CC(C)C)C(=O)N[C@H](C(O)C)C(=O)N(C)[C@@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C(C)C)C(=O)O	None
Smiles C(=O)N(C)[C@H](CC(C)C)C(=O)N[C@H](C(O)C)C(=O)N(C)[C@@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C(C)C)C(=O)O Postsynthetic modifications None Figure
	1	1	nrps-pks	Show	Open	Show	Scaffold Input	F * F * F * A * F * malonyl	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)CN[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)CN[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	9	1	pks	Show	Open	Show	Scaffold Input	malonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl	C=C(C)C=C(C)C=CC(O)CC(O)CC(O)C	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles C=C(C)C=C(C)C=CC(O)CC(O)CC(O)C Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	17	1	pks	Show	Open	Show	Scaffold Input	malonyl * malonyl * malonyl * malonyl * malonyl	CC=CC=CC(=O)CC=CCO	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC=CC=CC(=O)CC=CCO Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 50 entries

Previous1 2 3 4 5Next

Uploaded File: None

Record: NZ_CP033071.1

Comment: NZ_CP033071.1 Streptomyces albus strain ZD11 chromosome, complete genome

Change record: 0