SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	29	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * F	N[C@H](Cc1ccccc1)C(C)C=C(C)C=C(C)C(O)CC(O)CCCC=C(C)C(O)C(C)C(O)CCCC(O)C(C)C=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(C)C=C(C)C=C(C)C(O)CC(O)CCCC=C(C)C(O)C(C)C(O)CCCC(O)C(C)C=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	3	1	nrps	Show	Open	Show	Scaffold Input	G * G * T * S * L * T * F * V * S * F * G * S * horn	C(=O)NCC(=O)NCC(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@H](CCCNO)	None
Smiles C(=O)NCC(=O)NCC(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@H](CCCNO) Postsynthetic modifications None Figure
	27	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl	C=C(C)C(O)C(C)C=CCCC(O)C(C)C(O)C(C)C(O)C(C)C(O)C(C)CCC(O)C(C)C(=O)C(C)CC(C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C=C(C)C(O)C(C)C=CCCC(O)C(C)C(O)C(C)C(O)C(C)C(O)C(C)CCC(O)C(C)C(=O)C(C)CC(C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	33	2	pks	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * malonyl * malonyl * unknown * unknown * unknown * unknown * unknown	C(C)C=CC(=O)CC(=O)CC=C()C(=O)C()C(O)C()C(=O)C()C=C(*)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C=CC(=O)CC(=O)CC=C()C(=O)C()C(O)C()C(=O)C()C=C()C(=O)O Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	30	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl	C(C)C=C(C)C=CC=CC=CCCC=CC=CCO	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C=C(C)C=CC=CC=CCCC=CC=CCO Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	15	1	nrps	Show	Open	Show	Scaffold Input	F * L * D * W * G * V * V	N[C@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)NCC(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)NCC(=O)N[C@H](C(C)C)C(=O)N[C@H](C(C)C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	32	1	nrps	Show	Open	Show	Scaffold Input	S * T * horn * orn * T	N[C@@H](CO)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CCCNO)C(=O)N[C@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@@H](CO)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CCCNO)C(=O)N[C@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	12	1	nrps	Show	Open	Show	Scaffold Input	C * N * F * F * V	C(=O)N[C@H](C(C)C)C(=O)N[C@H](CS)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](C(C)C)C(=O)N[C@H](CS)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	4	1	nrps	Show	Open	Show	Scaffold Input	F * N * F * P	N[C@H](C1CCCN1)C(=O)N[C@H](Cc1ccccc1)C(=O)N(C)[C@H](CC(=O)N)C(=O)N[C@H](Cc1ccccc1)C(=O)O	None
Smiles N[C@H](C1CCCN1)C(=O)N[C@H](Cc1ccccc1)C(=O)N(C)[C@H](CC(=O)N)C(=O)N[C@H](Cc1ccccc1)C(=O)O Postsynthetic modifications None Figure
	33	1	nrps-pks	Show	Open	Show	Scaffold Input	G * unknown * unknown * F	N[C@H](Cc1ccccc1)C(=O)NCC=C()C(=O)C()C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)NCC=C()C(=O)C()C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 42 entries

Previous1 2 3 4 5Next

Uploaded File: None

Record: NC_010572.1

Comment: NC_010572.1 Streptomyces griseus subsp. griseus NBRC 13350, complete genome

Change record: 0