This site makes heavy use of Javascript.

In your browser, Javascript is either unsupported or deactivated. To make full use of this site, please either update your browser to a current version or activate Javascript. Also consider deactivating browser addons that can intefere with script execution for this site, such as NoScript for Firefox.

Uploaded File: None

Record: NZ_CP047140.1

Comment: NZ_CP047140.1 Streptomyces sp. Tu 2975 chromosome, complete genome

Change record: 0

Genome browser

Open genome browser

Project

Download project folder

Debug

Download Log

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	3	1	nrps-pks	Show	Open	Show	Scaffold Input	T * V * P * F * pip * hpg * S * unknown * unknown * G * unknown * unknown * unknown * unknown * S * unknown	C(=O)N[C@@H](CO)C=C()C=C()C(=O)NCC=C()C(=O)C()C=C()C(=O)C()C(=O)N[C@H](CO)C(=O)C(*)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C1CCCN1)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)N1[C@H](CCC1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:1
Smiles C(=O)N[C@@H](CO)C=C()C=C()C(=O)NCC=C()C(=O)C()C=C()C(=O)C()C(=O)N[C@H](CO)C(=O)C()C(=O)N[C@H](C(O)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C1CCCN1)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)N1[C@H](CCC1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)O Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:1 Figure
	7	1	nrps	Show	Open	Show	Scaffold Input	W * S * horn * F	C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](CO)C(=O)N[C@H](CCCNO)C(=O)N[C@H](Cc1ccccc1)	None
Smiles C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](CO)C(=O)N[C@H](CCCNO)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	11	1	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	29	3	nrps	Show	Open	Show	Scaffold Input	dhb * F	Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	16	1	nrps	Show	Open	Show	Scaffold Input	A * E	N[C@H](C)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](C)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	3	2	nrps-pks	Show	Open	Show	Scaffold Input	dhb * unknown	Oc1c(O)c(ccc1)C(=O)C(*)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:1
Smiles Oc1c(O)c(ccc1)C(=O)C() Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:1 Figure
	6	1	pks	Show	Open	Show	Scaffold Input	malonyl	CC(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	8	1	nrps	Show	Open	Show	Scaffold Input	F	N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	9	1	nrps	Show	Open	Show	Scaffold Input	F	N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	10	1	nrps	Show	Open	Show	Scaffold Input	L	N[C@H](CC(C)C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC(C)C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 36 entries

Previous1 2 3 4Next