SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	12	1	nrps-pks	Show	Open	Show	Scaffold Input	dhb * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl	Oc1c(O)c(ccc1)C(=O)CC(O)C(C)CC(C)C=C(C)C=CC=CC=CC=CC=CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CC(O)CCCCCC(O)CCCC=CC(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)CC(O)C(C)CC(C)C=C(C)C=CC=CC=CC=CC=CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CC(O)CCCCCC(O)CCCC=CC(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	10	1	nrps	Show	Open	Show	Scaffold Input	A * A * P * S * S * P	N[C@H](C1CCCN1)C(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:1
Smiles N[C@H](C1CCCN1)C(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:1 Figure
	9	1	nrps	Show	Open	Show	Scaffold Input	dhb * horn * S * orn * C	Oc1c(O)c(ccc1)C(=O)N[C@@H](CCCNO)C(=O)N[C@H](CO)C(=O)N[C@@H](CCCN)C(=O)N[C@H](CS)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)N[C@@H](CCCNO)C(=O)N[C@H](CO)C(=O)N[C@@H](CCCN)C(=O)N[C@H](CS) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	10	2	pks	Show	Open	Show	Scaffold Input	malonyl * malonyl * malonyl * malonyl * malonyl	CC=CC=CC(O)CC=CCO	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:1
Smiles CC=CC=CC(O)CC=CCO Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:1 Figure
	33	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * unknown * malonyl * F	CC(C)C(O)C(*)C=CC(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:2 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC(C)C(O)C()C=CC(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 NO2:0 * Cl:2 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	5	1	nrps	Show	Open	Show	Scaffold Input	A * G * T * F	N[C@H](C)C(=O)NCC(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C)C(=O)NCC(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	35	1	nrps	Show	Open	Show	Scaffold Input	F * A * Q	N[C@H](CCC(=O)N)N[C@H](Cc1ccccc1)C(=O)N[C@H](C)	None
Smiles N[C@H](CCC(=O)N)N[C@H](Cc1ccccc1)C(=O)N[C@H](C) Postsynthetic modifications None Figure
	6	2	nrps-pks	Show	Open	Show	Scaffold Input	V * P * unknown	N[C@H](C(C)C)C(=O)N[C@H](C1CCCN1)C(O)C(*)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C(C)C)C(=O)N[C@H](C1CCCN1)C(O)C()C(=O)O Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	32	1	nrps-pks	Show	Open	Show	Scaffold Input	F * malonyl * malonyl	N[C@H](Cc1ccccc1)C(=O)CC(=O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)CC(=O)CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	8	1	nrps	Show	Open	Show	Scaffold Input	dhb * F	Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1)	None
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure

Showing 1 to 10 of 46 entries

Previous1 2 3 4 5Next

Uploaded File: None

Record: NZ_CP029078.1

Comment: NZ_CP029078.1 Streptomyces griseoviridis strain K61 chromosome, complete genome

Change record: 0