SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	31	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * F	N[C@H](Cc1ccccc1)C(O)C(C)C(O)CC=CC(O)CC(O)CC=C(C)C(O)C(C)C(O)CC(O)CC(O)C(C)C(O)CC=C(C)C(O)C(C)C=CC(O)C(C)C=CCCC(O)C(C)C(O)C(C)C=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(O)C(C)C(O)CC=CC(O)CC(O)CC=C(C)C(O)C(C)C(O)CC(O)CC(O)C(C)C(O)CC=C(C)C(O)C(C)C=CC(O)C(C)C=CCCC(O)C(C)C(O)C(C)C=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	3	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl	C(C)C(O)C(C)CCC(O)CC(O)CC=C(C)C(O)CC=CC=CC(O)C(C)C=CC=CC=CC=CC=C	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles C(C)C(O)C(C)CCC(O)CC(O)CC=C(C)C(O)CC=CC=CC(O)C(C)C=CC=CC=CC=CC=C Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	39	1	nrps	Show	Open	Show	Scaffold Input	L * A * V * L * F * dhb * orn * T * aad * aad * dhb * V * F	N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](Cc1ccccc1)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](CCCC(=O)O)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc1ccccc1)	None
Smiles N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](Cc1ccccc1)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CCCC(=O)O)C(=O)N[C@H](CCCC(=O)O)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](Cc1ccccc1) Postsynthetic modifications None Figure
	22	1	nrps	Show	Open	Show	Scaffold Input	T * A * S * V * A * A * W	N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](C)C(=O)N[C@@H](CO)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)O	Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](C)C(=O)N[C@@H](CO)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	6	1	nrps	Show	Open	Show	Scaffold Input	V * A * A * S * A * D * F	N[C@@H](C(C)C)C(=O)N[C@H](C)C(=O)N[C@@H](C)C(=O)N(C)[C@H](CO)C(=O)N[C@@H](C)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](Cc1ccccc1)	None
Smiles N[C@@H](C(C)C)C(=O)N[C@H](C)C(=O)N[C@@H](C)C(=O)N(C)[C@H](CO)C(=O)N[C@@H](C)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	34	1	nrps	Show	Open	Show	Scaffold Input	F * V * D * V * A * V	N[C@H](Cc1ccccc1)C(=O)N(C)[C@H](C(C)C)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)O	None
Smiles N[C@H](Cc1ccccc1)C(=O)N(C)[C@H](C(C)C)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)O Postsynthetic modifications None Figure
	30	1	nrps-pks	Show	Open	Show	Scaffold Input	F * methylmalonyl * malonyl * methylmalonyl * malonyl	N[C@H](Cc1ccccc1)C=C(C)CCC(=O)C(C)C(=O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C=C(C)CCC(=O)C(C)C(=O)CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	36	1	nrps	Show	Open	Show	Scaffold Input	L * dhb * dhb * dhb	Oc1c(O)c(ccc1)C(=O)N[C@H](CC(C)C)C(=O)Oc1c(O)c(ccc1)C(=O)Oc1c(O)c(ccc1)	None
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](CC(C)C)C(=O)Oc1c(O)c(ccc1)C(=O)Oc1c(O)c(ccc1) Postsynthetic modifications None Figure
	33	2	nrps	Show	Open	Show	Scaffold Input	V * W * F * A	N(C)[C@H](C(C)C)C(=O)N(C)[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N(C)[C@H](C(C)C)C(=O)N(C)[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	35	1	nrps	Show	Open	Show	Scaffold Input	F * A * dhb	C(=O)N[C@H](C)C(=O)Oc1c(O)c(ccc1)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](C)C(=O)Oc1c(O)c(ccc1)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 44 entries

Previous1 2 3 4 5Next

Uploaded File: None

Record: NZ_CP021748.1

Comment: NZ_CP021748.1 Streptomyces alboflavus strain MDJK44 chromosome, complete genome

Change record: 0 1 2