SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	8	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * F	N[C@H](Cc1ccccc1)C(O)C(C)C(O)CC=CC(O)CC(O)CC=C(C)C(O)C(C)C(O)CC(O)CC(O)C(C)C(O)CC=C(C)C(O)C(C)C=CC(O)C(C)C=CCCC(O)C(C)C(O)C(C)CCC=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:1
Smiles N[C@H](Cc1ccccc1)C(O)C(C)C(O)CC=CC(O)CC(O)CC=C(C)C(O)C(C)C(O)CC(O)CC(O)C(C)C(O)CC=C(C)C(O)C(C)C=CC(O)C(C)C=CCCC(O)C(C)C(O)C(C)CCC=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:1 Figure
	5	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * F	CCC(=O)N[C@H](Cc1ccccc1)C=C(C)C(O)C(C)C=CC=C(C)C(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(=O)CC(O)C(C)CCC(O)C(C)C(O)CC(O)C(C)C=CC=CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles CCC(=O)N[C@H](Cc1ccccc1)C=C(C)C(O)C(C)C=CC=C(C)C(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(=O)CC(O)C(C)CCC(O)C(C)C(O)CC(O)C(C)C=CC=CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	37	1	nrps	Show	Open	Show	Scaffold Input	L * A * V * L * L * orn * T * orn * V * L	N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C)	None
Smiles N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C) Postsynthetic modifications None Figure
	4	1	nrps	Show	Open	Show	Scaffold Input	D * T * S * dhb * T * T * S * F * G * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)N[C@H](Cc1ccccc1)C(=O)N(C)CC(=O)O	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)N[C@H](Cc1ccccc1)C(=O)N(C)CC(=O)O Postsynthetic modifications None Figure
	36	1	nrps-pks	Show	Open	Show	Scaffold Input	F * F * A * T * F * F * unknown * W * dhb	Oc1c(O)c(ccc1)N[C@H](Cc1ccccc1)C(=O)C(*)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)N[C@H](Cc1ccccc1)C(=O)C()C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)N[C@H](C(O)C)C(=O)N[C@H](Cc1ccccc1)C(=O)O Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	8	2	nrps-pks	Show	Open	Show	Scaffold Input	F * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl	N[C@H](Cc1ccccc1)C=C(C)C=C(C)C=C(C)CCC(=O)C(C)C(=O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:1
Smiles N[C@H](Cc1ccccc1)C=C(C)C=C(C)C=C(C)CCC(=O)C(C)C(=O)CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:1 Figure
	16	3	nrps	Show	Open	Show	Scaffold Input	W * A * A * A * A * A	N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](C)C(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](C)C(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	13	1	nrps	Show	Open	Show	Scaffold Input	F * A * F * L * F * L	N[C@@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)O	None
Smiles N[C@@H](Cc1ccccc1)C(=O)N[C@H](C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)O Postsynthetic modifications None Figure
	2	1	nrps	Show	Open	Show	Scaffold Input	V * A * A * V * A * V	N[C@@H](C(C)C)C(=O)N[C@H](C)C(=O)N[C@@H](C)C(=O)N(C)[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@@H](C(C)C)C(=O)N[C@H](C)C(=O)N[C@@H](C)C(=O)N(C)[C@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	7	1	nrps	Show	Open	Show	Scaffold Input	P * P * L * P * P	N[C@H](C1CCCN1)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](CC(C)C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C1CCCN1)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](CC(C)C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 49 entries

Previous1 2 3 4 5Next

Uploaded File: None

Record: NZ_CP048641.1

Comment: NZ_CP048641.1 Streptomyces aureoverticillatus strain HN6 chromosome, complete genome

Change record: 0 1