SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	7	1	nrps-pks	Show	Open	Show	Scaffold Input	dhb * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl	Oc1c(O)c(ccc1)C=CC(O)CC=CC(O)CC=CC(O)CC=CC(O)CC=CC(O)CC=CC(O)C(C)C(O)CC=CC=CC=CC=CC(O)C(C)C(O)C(C)C=CCCC=CC=CC=C(C)C(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C=CC(O)CC=CC(O)CC=CC(O)CC=CC(O)CC=CC(O)CC=CC(O)C(C)C(O)CC=CC=CC=CC=CC(O)C(C)C(O)C(C)C=CCCC=CC=CC=C(C)C(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	1	1	nrps	Show	Open	Show	Scaffold Input	G * orn * S * S * horn * horn * dhb	Oc1c(O)c(ccc1)C(=O)NCC(=O)N[C@H](CCCN)C(=O)N[C@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@H](CCCNO)C(=O)N[C@H](CCCNO)C(=O)O	None
Smiles Oc1c(O)c(ccc1)C(=O)NCC(=O)N[C@H](CCCN)C(=O)N[C@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@H](CCCNO)C(=O)N[C@H](CCCNO)C(=O)O Postsynthetic modifications None Figure
	6	1	nrps-pks	Show	Open	Show	Scaffold Input	A * T * horn * malonyl	N[C@@H](C)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CCCNO)C(=O)C	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@@H](C)C(=O)N[C@@H](C(O)C)C(=O)N[C@H](CCCNO)C(=O)C Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	18	2	nrps	Show	Open	Show	Scaffold Input	F * F * T * P	C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C(O)C)N[C@H](C1CCCN1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C(O)C)N[C@H](C1CCCN1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	21	1	nrps	Show	Open	Show	Scaffold Input	F * F * G * L	C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](CC(C)C)C(=O)O	None
Smiles C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](CC(C)C)C(=O)O Postsynthetic modifications None Figure
	5	2	nrps	Show	Open	Show	Scaffold Input	F * L * S	N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	30	1	nrps	Show	Open	Show	Scaffold Input	F * A	N[C@H](Cc1ccccc1)C(=O)N[C@H](C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	20	1	nrps	Show	Open	Show	Scaffold Input	D * E	N[C@H](CC(=O)O)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](CC(=O)O)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	4	1	nrps	Show	Open	Show	Scaffold Input	dhb * F	Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	9	1	nrps	Show	Open	Show	Scaffold Input	F	N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 38 entries

Previous1 2 3 4Next

Uploaded File: None

Record: NZ_CP029189.1

Comment: NZ_CP029189.1 Streptomyces venezuelae strain ATCC 21018 chromosome, complete genome

Change record: 0