SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	31	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * dhb * malonyl	Oc1c(O)c(ccc1)C(=O)CC(O)CC(O)CC=CC(O)CC(O)CC=CC(O)CC=CC(O)CC=CC(O)C(C)C(O)CC=CC=CC=CC=CC(O)C(C)C(O)C(C)C=CCCC=CC=CC=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)CC(O)CC(O)CC=CC(O)CC(O)CC=CC(O)CC=CC(O)CC=CC(O)C(C)C(O)CC=CC=CC=CC=CC(O)C(C)C(O)C(C)C=CCCC=CC=CC=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	12	3	pks	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl	CC=C(C)CC(C)C=CCC(C)C=C(C)CCC=C(C)CCC(O)CC(O)C(C)C(O)C(C)CC(C)C(=O)C	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:1
Smiles CC=C(C)CC(C)C=CCC(C)C=C(C)CCC=C(C)CCC(O)CC(O)C(C)C(O)C(C)CC(C)C(=O)C Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:1 Figure
	15	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * malonyl	C(=O)C(C)C(O)CCC(C)CC(C)C(O)C(C)C(O)CC=C(C)C(O)CC=C(C)C=CC=C(C)C=C(C)C=CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)C(C)C(O)CCC(C)CC(C)C(O)C(C)C(O)CC=C(C)C(O)CC=C(C)C=CC=C(C)C=C(C)C=CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	39	1	pks	Show	Open	Show	Scaffold Input	malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl	C(=O)CC(O)CCCC=CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CC(O)CC=CCCC(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)CC(O)CCCC=CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CC(O)CC=CCCC(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	12	2	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * methylmalonyl * malonyl * unknown * unknown * unknown * unknown * unknown * F * W	CC=C()C(=O)C()C(O)C()C(=O)C()C(O)C(*)(C)C(=O)N[C@H](Cc1ccccc1)C(=O)N(C)[C@H](CC1=CNC(=C12)C=CC=C2)C(C)C(O)CC(O)C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:1
Smiles CC=C()C(=O)C()C(O)C()C(=O)C()C(O)C()(C)C(=O)N[C@H](Cc1ccccc1)C(=O)N(C)[C@H](CC1=CNC(=C12)C=CC=C2)C(C)C(O)CC(O)C(C)C(=O)O Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:1 Figure
	38	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * ethylmalonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl	C(C)C=C(CC)C=C(C)C=CC=CC(=O)C(C)C(=O)CC(=O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)C=C(CC)C=C(C)C=CC=CC(=O)C(C)C(=O)CC(=O)CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	8	1	nrps-pks	Show	Open	Show	Scaffold Input	F * L * V * malonyl	C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C(C)C)C=CC(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C(C)C)C=CC(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	28	1	nrps	Show	Open	Show	Scaffold Input	S * P * Q	N[C@H](CCC(=O)N)C(=O)N[C@H](CO)C(=O)N[C@H](C1CCCN1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CCC(=O)N)C(=O)N[C@H](CO)C(=O)N[C@H](C1CCCN1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	3	1	nrps	Show	Open	Show	Scaffold Input	V * N * N	C(=O)N[C@H](C(C)C)C(=O)N(C)[C@H](CC(=O)N)C(=O)N[C@H](CC(=O)N)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](C(C)C)C(=O)N(C)[C@H](CC(=O)N)C(=O)N[C@H](CC(=O)N)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	8	2	nrps-pks	Show	Open	Show	Scaffold Input	F * F * malonyl	CC(C)C(=O)N[C@H](Cc1ccccc1)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC(C)C(=O)N[C@H](Cc1ccccc1)C(=O)N(C)[C@H](Cc1ccccc1)C(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 50 entries

Previous1 2 3 4 5Next

Uploaded File: None

Record: NZ_CP031455.1

Comment: NZ_CP031455.1 Streptomyces olivoreticuli subsp. olivoreticuli strain ATCC 31159 chromosome, comp...

Change record: 0