SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	35	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * F	N[C@H](Cc1ccccc1)C(O)C(C)C(O)CC=CC(O)CC(O)CC=C(C)C(O)C(C)C(O)CC(O)CC(O)CC(O)CC=C(C)C(O)C(C)C=CC(O)C(C)C=CCCC(O)C(C)C(O)C(C)CCC=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(O)C(C)C(O)CC=CC(O)CC(O)CC=C(C)C(O)C(C)C(O)CC(O)CC(O)CC(O)CC=C(C)C(O)C(C)C=CC(O)C(C)C=CCCC(O)C(C)C(O)C(C)CCC=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	6	1	pks-nrps	Show	Open	Show	Scaffold Input	unknown * unknown * unknown * unknown * G * unknown * unknown * G * unknown * unknown * unknown * unknown * unknown * unknown * S * T * T * V	C=C()C(O)C()C(=O)C()C(=O)C()C(=O)NCC=C()C(=O)C()C(=O)NCC(O)C()C(=O)C()C(O)C()C(=O)C()C(O)C()C(=O)C()C(=O)N[C@H](CO)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(O)C)C(=O)N(C)[C@H](C(C)C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C=C()C(O)C()C(=O)C()C(=O)C()C(=O)NCC=C()C(=O)C()C(=O)NCC(O)C()C(=O)C()C(O)C()C(=O)C()C(O)C()C(=O)C()C(=O)N[C@H](CO)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(O)C)C(=O)N(C)[C@H](C(C)C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	7	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl	C(C)C(O)C(C)CCC(O)CC=CC(O)CC=C(C)C=CC=CC(O)CC(O)CC=CC=CC=CC=C(C)C(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles C(C)C(O)C(C)CCC(O)CC=CC(O)CC=C(C)C=CC=CC(O)CC(O)CC=CC=CC=CC=C(C)C(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	7	2	nrps-pks	Show	Open	Show	Scaffold Input	F * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl	N[C@H](Cc1ccccc1)C(=O)C(C)C(O)C(C)C(O)CC(=O)C(C)C(O)C(C)C(O)C(C)C=CCC(C)C(O)C(C)C=C(C)C=C(C)C(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)C(C)C(O)C(C)C(O)CC(=O)C(C)C(O)C(C)C(O)C(C)C=CCC(C)C(O)C(C)C=C(C)C=C(C)C(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:1 * Sphingo:0 * 5-Ring:0 Figure
	36	1	pks	Show	Open	Show	Scaffold Input	methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl	C=C(C)C(=O)CC(O)C(C)C=C(C)C=C(C)C=C(C)C=C(C)C=C(C)C=CC=C(C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C=C(C)C(=O)CC(O)C(C)C=C(C)C=C(C)C=C(C)C=C(C)C=C(C)C=CC=C(C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	47	1	nrps	Show	Open	Show	Scaffold Input	L * A * V * L * L * orn * T * orn * V * L	N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C)	None
Smiles N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C) Postsynthetic modifications None Figure
	37	1	nrps	Show	Open	Show	Scaffold Input	hpg * Y * W * hpg * hpg * bht * dhpg * dhb	N[C@H](CNc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@H](C(O)c1ccc(O)cc1)C(=O)N[C@H](c1cc(O)cc(O)c1)C(=O)Oc1c(O)c(ccc1)C(=O)O	Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CNc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@H](C(O)c1ccc(O)cc1)C(=O)N[C@H](c1cc(O)cc(O)c1)C(=O)Oc1c(O)c(ccc1)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	10	1	nrps	Show	Open	Show	Scaffold Input	L * W * hpg * hpg * hpg * Y * hpg * L	N[C@H](CC(C)C)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](CC(C)C)C(=O)O	Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC(C)C)C(=O)N[C@@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](CNc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CNc1ccc(O)cc1)C(=O)N[C@H](CC(C)C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:1 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	34	1	nrps-pks	Show	Open	Show	Scaffold Input	F * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * methylmalonyl * malonyl	N[C@H](Cc1ccccc1)C=C(C)C=C(C)C=C(C)CCC(=O)C(C)C(=O)CC(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C=C(C)C=C(C)C=C(C)CCC(=O)C(C)C(=O)CC(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	nrps	Show	Open	Show	Scaffold Input	V * S * A * S * Q * W * Q	C(=O)N[C@@H](C(C)C)C(=O)N[C@H](CO)C(=O)N[C@H](C)C(=O)N[C@H](CO)C(=O)N[C@H](CCC(=O)N)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CCC(=O)N)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@@H](C(C)C)C(=O)N[C@H](CO)C(=O)N[C@H](C)C(=O)N[C@H](CO)C(=O)N[C@H](CCC(=O)N)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)N[C@H](CCC(=O)N)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure

Showing 1 to 10 of 62 entries

Previous1 2 3 4 5 6 7Next

Uploaded File: None

Record: NZ_CP030771.1

Comment: NZ_CP030771.1 Streptomyces sp. YIM 121038 chromosome, complete genome

Change record: 0 1