This site makes heavy use of Javascript.

In your browser, Javascript is either unsupported or deactivated. To make full use of this site, please either update your browser to a current version or activate Javascript. Also consider deactivating browser addons that can intefere with script execution for this site, such as NoScript for Firefox.

Uploaded File: None

Record: NZ_CP019779.1

Comment: NZ_CP019779.1 Streptomyces sp. MOE7 chromosome, complete genome

Change record: 0

Genome browser

Open genome browser

Project

Download project folder

Debug

Download Log

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	9	2	pks	Show	Open	Show	Scaffold Input	malonyl * methylmalonyl * malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * malonyl	CC(O)C(C)C(O)CC=C(C)C(O)C(C)C=C(C)C=CC(O)CC(=O)O	Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC(O)C(C)C(O)CC=C(C)C(O)C(C)C=C(C)C=CC(O)CC(=O)O Postsynthetic modifications Glyco:2 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	nrps-pks	Show	Open	Show	Scaffold Input	S * T * A * T * malonyl * A	C(=O)N[C@H](C(O)C)C(=O)CC(=O)N[C@H](C)C(=O)N[C@H](CO)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](C(O)C)C(=O)CC(=O)N[C@H](C)C(=O)N[C@H](CO)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	24	1	nrps	Show	Open	Show	Scaffold Input	T * G * F * Y * F	N[C@H](C(O)C)C(=O)NCC(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](Cc1ccccc1)	None
Smiles N[C@H](C(O)C)C(=O)NCC(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	35	2	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * methylmalonyl * malonyl * C	C(C)CC(C)C(=O)CC(=O)N[C@H](CS)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(C)CC(C)C(=O)CC(=O)N[C@H](CS)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	37	1	nrps	Show	Open	Show	Scaffold Input	A * L * V	C(=O)N[C@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C(C)C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C(C)C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	30	1	nrps	Show	Open	Show	Scaffold Input	aad * P	N[C@H](CCCC(=O)O)C(=O)N[C@H](C1CCCN1)	Glyco:0 * NO2:0 * Cl:3 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CCCC(=O)O)C(=O)N[C@H](C1CCCN1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:3 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	21	1	nrps	Show	Open	Show	Scaffold Input	F * E	N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	7	1	nrps	Show	Open	Show	Scaffold Input	aad * F	N[C@H](CCCC(=O)O)C(=O)N[C@H](Cc1ccccc1)	None
Smiles N[C@H](CCCC(=O)O)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	19	1	pks-nrps	Show	Open	Show	Scaffold Input	methylmalonyl * F	N[C@H](Cc1ccccc1)CC(C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)CC(C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	34	1	nrps	Show	Open	Show	Scaffold Input	G * F	NCC(=O)N[C@H](Cc1ccccc1)	None
Smiles NCC(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure

Showing 1 to 10 of 44 entries

Previous1 2 3 4 5Next