SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	26	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * A * F * malonyl * malonyl * methylmalonyl * malonyl	CC(=O)N[C@H](C)C(=O)N[C@H](Cc1ccccc1)C=CC=CC=C(C)C=CC=CC(O)CC=CC=C(C)C=CC(=O)CC(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC(=O)N[C@H](C)C(=O)N[C@H](Cc1ccccc1)C=CC=CC=C(C)C=CC=CC(O)CC=CC=C(C)C=CC(=O)CC(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	3	1	nrps	Show	Open	Show	Scaffold Input	L * A * V * A * L * orn * T * orn * V * L	N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	1	1	nrps	Show	Open	Show	Scaffold Input	N * L * L * V * S * N * N * N	C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)N)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@H](CC(=O)N)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)N)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@H](CC(=O)N)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	10	1	nrps	Show	Open	Show	Scaffold Input	F * F * T * V	C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(C)C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(C)C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	9	1	nrps	Show	Open	Show	Scaffold Input	S * A * S * P	C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](C)C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](C1CCCN1)C(=O)N[C@H](C)C(=O)N[C@H](CO)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	10	2	nrps	Show	Open	Show	Scaffold Input	G * W	C(=O)NCC(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)NCC(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	17	1	nrps	Show	Open	Show	Scaffold Input	F * E	N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	16	1	nrps	Show	Open	Show	Scaffold Input	F * E	N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	7	1	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	13	1	nrps	Show	Open	Show	Scaffold Input	F	N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure

Showing 1 to 10 of 31 entries

Previous1 2 3 4Next

Uploaded File: None

Record: NZ_CP053189.1

Comment: NZ_CP053189.1 Streptomyces sp. jing01 chromosome, complete genome

Change record: 0