SeMPI 2.0

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	13	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * A * F * malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * methylmalonyl * malonyl * malonyl	CC(=O)N[C@H](C)C(=O)N[C@H](Cc1ccccc1)C=CC=CC=C(C)C=CC=CC(O)CC=CC=C(C)C=CC(=O)CC(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles CC(=O)N[C@H](C)C(=O)N[C@H](Cc1ccccc1)C=CC=CC=C(C)C=CC=CC(O)CC=CC=C(C)C=CC(=O)CC(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	36	1	nrps	Show	Open	Show	Scaffold Input	L * A * V * A * L * orn * T * orn * V * L	N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(O)C)C(=O)N[C@@H](CCCN)C(=O)N[C@H](C(C)C)C(=O)N[C@@H](CC(C)C) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	10	1	nrps	Show	Open	Show	Scaffold Input	N * L * L * V * S * N * N * N	C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)N)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@H](CC(=O)N)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)N)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@H](CC(=O)N)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	8	1	nrps	Show	Open	Show	Scaffold Input	T * S * N * D * V * S	N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)O	None
Smiles N[C@H](C(O)C)C(=O)N[C@H](CO)C(=O)N[C@H](CC(=O)N)C(=O)N[C@H](CC(=O)O)C(=O)N[C@H](C(C)C)C(=O)N[C@H](CO)C(=O)O Postsynthetic modifications None Figure
	31	2	nrps	Show	Open	Show	Scaffold Input	F * F * T * V	C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(C)C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](C(O)C)C(=O)N[C@H](C(C)C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	12	1	nrps-pks	Show	Open	Show	Scaffold Input	F * unknown * F	N[C@H](Cc1ccccc1)C(=O)C(*)C(=O)N[C@@H](Cc1ccccc1)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)C()C(=O)N[C@@H](Cc1ccccc1)C(=O)O Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	6	1	nrps-pks	Show	Open	Show	Scaffold Input	A * unknown * F	N[C@H](Cc1ccccc1)C(=O)C(*)C(=O)N[C@H](C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)C()C(=O)N[C@H](C)C(=O)O Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	6	2	nrps-pks	Show	Open	Show	Scaffold Input	V * P * unknown	N[C@H](C(C)C)C(=O)N[C@H](C1CCCN1)C(O)C(*)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](C(C)C)C(=O)N[C@H](C1CCCN1)C(O)C()C(=O)O Postsynthetic modifications Glyco:0 NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	2	1	nrps	Show	Open	Show	Scaffold Input	F * P * F	N[C@H](Cc1ccccc1)N[C@H](Cc1ccccc1)C(=O)N[C@H](C1CCCN1)	None
Smiles N[C@H](Cc1ccccc1)N[C@H](Cc1ccccc1)C(=O)N[C@H](C1CCCN1) Postsynthetic modifications None Figure
	2	2	nrps	Show	Open	Show	Scaffold Input	F * S * G	N[C@H](Cc1ccccc1)C(=O)N[C@H](CO)C(=O)NCC(=O)O	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](CO)C(=O)NCC(=O)O Postsynthetic modifications None Figure

Showing 1 to 10 of 47 entries

Previous1 2 3 4 5Next

Uploaded File: None

Record: NC_020895.1

Comment: NC_020895.1 Streptomyces hygroscopicus subsp. jinggangensis TL01, complete genome

Change record: 0 1 2