This site makes heavy use of Javascript.

In your browser, Javascript is either unsupported or deactivated. To make full use of this site, please either update your browser to a current version or activate Javascript. Also consider deactivating browser addons that can intefere with script execution for this site, such as NoScript for Firefox.

Uploaded File: None

Record: NZ_CP020569.1

Comment: NZ_CP020569.1 Streptomyces gilvosporeus strain F607 chromosome, complete genome

Change record: 0

Genome browser

Open genome browser

Project

Download project folder

Debug

Download Log

Show entries

Search:

	Cluster	Block	Type	DB screening	Cluster browser	Domains	Modify scaffold	Specificity	Smiles	Postsynthetic modifications
	14	1	nrps	Show	Open	Show	Scaffold Input	G * N * N * dhb * L * dhb * P * G * L * G * N * W	NCC(=O)N[C@H](CC(=O)N)C(=O)N[C@H](CC(=O)N)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](CC(C)C)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](C1CCCN1)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@H](CC(=O)N)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles NCC(=O)N[C@H](CC(=O)N)C(=O)N[C@H](CC(=O)N)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](CC(C)C)C(=O)Oc1c(O)c(ccc1)C(=O)N[C@H](C1CCCN1)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@H](CC(=O)N)C(=O)N[C@H](CC1=CNC(=C12)C=CC=C2)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	7	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * malonyl * methylmalonyl * malonyl * malonyl * malonyl * malonyl * malonyl * dhb * malonyl * malonyl * malonyl	Oc1c(O)c(ccc1)C(=O)CC(O)CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CC(O)CC=CC=CC(=O)O	Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)CC(O)CC=CC=CC(O)CC(O)C(C)C(O)CC(O)CC(O)CC=CC=CC(=O)O Postsynthetic modifications Glyco:3 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	31	1	pks-nrps	Show	Open	Show	Scaffold Input	malonyl * methylmalonyl * methylmalonyl * methylmalonyl * malonyl * malonyl * methylmalonyl * F	N[C@H](Cc1ccccc1)CCCC(C)C=C(C)C(O)C(C)C=CC=CC=C(C)C(=O)O	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)CCCC(C)C=C(C)C(O)C(C)C=CC=CC=C(C)C(=O)O Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	12	1	nrps	Show	Open	Show	Scaffold Input	dhb * F	Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles Oc1c(O)c(ccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	12	2	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	33	1	nrps	Show	Open	Show	Scaffold Input	F * F	N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1)C(=O)N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure
	21	1	nrps	Show	Open	Show	Scaffold Input	A * E	N[C@H](C)C(=O)N[C@H](CCC(=O)O)	None
Smiles N[C@H](C)C(=O)N[C@H](CCC(=O)O) Postsynthetic modifications None Figure
	8	1	nrps	Show	Open	Show	Scaffold Input	F	N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	9	1	nrps	Show	Open	Show	Scaffold Input	F	N[C@H](Cc1ccccc1)	Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0
Smiles N[C@H](Cc1ccccc1) Postsynthetic modifications Glyco:0 * NO2:0 * Cl:0 * SS:0 * 6-Ring:0 * Sphingo:0 * 5-Ring:0 Figure
	10	1	nrps	Show	Open	Show	Scaffold Input	F	N[C@H](Cc1ccccc1)	None
Smiles N[C@H](Cc1ccccc1) Postsynthetic modifications None Figure

Showing 1 to 10 of 44 entries

Previous1 2 3 4 5Next