Cluster scaffolds:

O OH OH OH O

1

Putative metabolites:


Name Rank Metabolite Score Similarity MCS Score Post-Mod Score Post-Mod Info Source Link Smiles Molview Full Name Figure
maklamicin 5 0.62 0.55 0.76 0.25 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:1/3 MIBiG Source C[C@H]1CC[C@@H]2[C@H](C=C[C@H]3[C@H](C)/C=C\C[C@]4(C)C=C(CO)[C@H](C[C@@H](C)O)C[C@]45OC(=O)/C(=C(\O)[C@@]23C)C5=O)C1 view maklamicin OH OH O O OH O H H H
Aurafuron A 25 0.53 0.5 0.68 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CC1=C(CC(O)/C=C\C=C\C(C)C(O)/C(C)=C/CC(C)C)OC(C)(O)C1=O view Aurafuron A OH HO O OH O
FD-891 6 0.61 0.56 0.8 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CO[C@@H](C)[C@@H](C)[C@H](O)[C@H](C)[C@@H](O)CCC(C)[C@@H]1C/C=C\C=C/CC(O)C2O[C@H]2[C@@H](O)[C@H](C)/C=C(C)\C=C(\C)C(=O)O1 view FD-891 O OH OH HO O HO O O H
oligomycin 4 0.63 0.51 0.73 0.6 6-Ring:2/3 * Sphingo:1/1 * 5-Ring:0/3 MIBiG Source CC[C@@H]1/C=C\C=C/C[C@H](C)[C@@H](O)[C@](C)(O)C(=O)[C@H](C)[C@@H](O)[C@H](C)C(=O)[C@H](C)[C@@H](O)[C@H](C)/C=C\C(=O)O[C@H]2[C@@H](C)[C@@H](CC1)O[C@@]1(CC[C@@H](C)[C@@H](C[C@H](C)O)O1)[C@@H]2C view oligomycin HO HO O HO O OH O O O OH O H H H
nemadectin 0 0.68 0.52 0.79 0.73 6-Ring:2/3 * Sphingo:1/1 * 5-Ring:1/3 MIBiG Source CC1=C[C@H]2C(=O)O[C@H]3C[C@@H](C/C=C(/C)C[C@@H](C)/C=C\C=C4\CO[C@H]([C@@H]1O)[C@@]42O)OC1(C3)C[C@H](O)[C@H](C)[C@@H](/C(C)=C/C(C)C)O1 view nemadectin O O O HO HO O OH O H H H H
tetronasin 1 0.66 0.5 0.79 0.6 6-Ring:1/3 * Sphingo:0/1 * 5-Ring:2/3 MIBiG Source CO[C@@H](C)[C@H]1C[C@H](C)[C@H]([C@@H](C)/C=C/[C@@H]2CC[C@@H](C)[C@H](/C(=C/[C@H]3CCC[C@@H](C)[C@@H]3[C@H](C)/C(O)=C3/C(=O)COC3=O)CO)O2)O1 view tetronasin O OH O O O OH O O
salinomycin 2 0.64 0.49 0.73 0.77 6-Ring:3/3 * Sphingo:2/1 * 5-Ring:1/3 MIBiG Source CC[C@@H](C(=O)O)C1CC[C@H](C)[C@H]([C@@H](C)[C@H](O)[C@H](C)C(=O)[C@H](CC)[C@H]2O[C@@]3(C=C[C@@H](O)[C@@]4(CC[C@@](C)([C@H]5CC[C@](O)(CC)[C@H](C)O5)O4)O3)[C@H](C)C[C@@H]2C)O1 view salinomycin O OH HO O O HO OH O O O O
tautomycin 3 0.63 0.51 0.73 0.6 6-Ring:2/3 * Sphingo:1/1 * 5-Ring:0/3 MIBiG Source CO[C@@H]([C@H](O)CC(=O)[C@@H](C)[C@@H](O)CC[C@@H](C)[C@@H]1O[C@@]2(CC[C@@H]1C)CC[C@@H](C)[C@H](CC[C@H](C)C(C)=O)O2)[C@H](OC(=O)C[C@@H](O)C1=C(C)C(=O)OC1=O)C(C)C view tautomycin O OH O OH O O O O O HO O O O
Kendomycin 7 0.61 0.54 0.76 0.25 6-Ring:1/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CC1=C2O[C@]3(O)C=C2C(=C(O)C1=O)[C@@H]1O[C@H](CC[C@H](C)/C=C(/C)C[C@@H](C)C[C@@H]3C)[C@H](C)[C@H](O)[C@H]1C view Kendomycin O OH OH O O OH H H
Spirangien A1 8 0.61 0.49 0.7 0.6 6-Ring:2/3 * Sphingo:1/1 * 5-Ring:0/3 MIBiG Source C/C=C(\C)C[C@H](C)[C@H](O)[C@@H](C)[C@H]1O[C@@]2(C[C@@H](OC)[C@H]1C)O[C@H]([C@@H](C)[C@@H](O)[C@@H](C)/C=C\C=C\C=C/C=C/C=C\[C@H](CC(=O)O)OC)[C@@H](C)C[C@@H]2O view Spirangien A1 OH O O O OH O HO O OH
concanamycin A 9 0.6 0.53 0.75 0.25 6-Ring:1/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source C/C=C/[C@H]1O[C@@](O)([C@@H](C)[C@H](O)[C@H](C)[C@H]2OC(=O)/C(OC)=C\C(C)=C/[C@@H](C)[C@@H](O)[C@@H](CC)[C@@H](O)[C@H](C)C/C(C)=C\C=C/[C@@H]2OC)C[C@@H](O)[C@@H]1C view concanamycin A O OH OH O O O OH OH O OH
Bafilomycin B1 10 0.6 0.55 0.73 0.25 6-Ring:1/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CO/C1=C/C(C)=C\[C@@H](C)[C@@H](O)[C@H](C)C/C(C)=C\C=C/[C@H](OC)[C@@H]([C@@H](C)[C@@H](O)[C@H](C)[C@@]2(O)C[C@@H](O)[C@H](C)[C@@H](C(C)C)O2)OC1=O view Bafilomycin B1 O HO O OH HO OH O O O
tetronomycin 11 0.6 0.48 0.73 0.44 6-Ring:1/3 * Sphingo:0/1 * 5-Ring:1/3 MIBiG Source C=C1OC(=O)C(C(=O)[C@H](C)[C@@H]2[C@@H](C)CCC[C@H]2/C=C(\CO)[C@H]2O[C@@H](/C=C/C[C@@H]3CC[C@@H]([C@@H](C)OC)O3)CC[C@@H]2C)=C1[O-].[Na+] view tetronomycin O O O HO O O O O- Na+
Thaliandiol 12 0.59 0.51 0.79 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CC(C)=CC(=O)C[C@@H](C)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](O)C[C@H](O)[C@@]45C[C@@]35CC[C@]12C view Thaliandiol O OH HO H H
JBIR-100 13 0.59 0.53 0.72 0.25 6-Ring:1/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source C/C1=C/C(C)C(O)C(C)C/C(C)=C\C=C/CC(C(C)C(O)C(C)C2(O)CC(OC(=O)/C=C/C(=O)O)C(C)C(C(C)C)O2)OC(=O)\C(C)=C/1 view JBIR-100 HO OH HO O O O OH O O O
meridamycin 14 0.59 0.55 0.71 0.25 6-Ring:1/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CC/C1=C/C[C@@H](/C(C)=C/[C@@H](C)[C@@H](C)O)OC(=O)C2CCCCN2C(=O)C(=O)[C@]2(O)O[C@@H](CC[C@H]2C)C[C@H](O)[C@H](C)[C@@H](O)C[C@@H](O)C[C@H](O)/C(C)=C\[C@@H](C)CC(C)[C@@H]1O view meridamycin OH O O N O O OH O HO HO HO OH OH H
tirucalla 15 0.58 0.53 0.77 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CC(C)=CCC[C@H](C)[C@@H]1CC[C@]2(C)C3=CC[C@H]4C(C)(C)[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]12C view tirucalla HO H H
Thalianol 16 0.57 0.56 0.73 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CC(C)=CCC/C(C)=C/CC[C@@H](C)[C@@]1(C)CCC2=C1CC[C@H]1C(C)(C)[C@@H](O)CC[C@]21C view Thalianol OH H
heronamide D 17 0.56 0.52 0.73 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source C/C=C/C=C/CC1C[C@H](O)C2C3/C(C)=C\C4C=C[C@@H](O)[C@@H](O)C4/C(C)=C\C=C/C3C(=O)N12 view heronamide D OH OH OH O N
E-837 18 0.56 0.54 0.71 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source C/C=C(\C)C(O)C(C)/C=C/C=C(\C)CCC(O)CC1=C(C)C(=O)C(C)(O)O1 view E-837 OH OH O OH O
E-975 19 0.55 0.53 0.7 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CC/C=C(\C)C(O)C(C)/C=C/C=C/CCC(O)CC1=C(C)C(=O)C(O)(C(C)O)O1 view E-975 OH OH O OH HO O
macrobrevin 20 0.55 0.57 0.67 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CCC(C)C(O)/C=C/C(C)=C/C=C/C(C)CC(C)C1CC(O)C(C)/C=C\C=C/C(C)C/C=C(/C)C(O)/C=C\CC(O)C(C)/C=C\C(=O)O1 view macrobrevin OH OH HO OH O O
halstoctacosanolide 21 0.55 0.53 0.63 0.25 6-Ring:1/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CCC(O)C(C)C(O)CC(O)C(O)/C=C(\C)CC(C)C1CC(O)C(C)/C=C\C=C/CC(C)C(=O)CC2CCC(C)C(O)(C/C=C(C)\C=C(\C)C(O)C(=O)/C=C(/C)C(=O)O1)O2 view halstoctacosanolide OH OH OH OH HO O OH OH O O O O
Borrelidin 22 0.54 0.51 0.7 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source C[C@@H]1C[C@H](C)[C@@H](O)CC(=O)O[C@H]([C@@H]2CCC[C@H]2C(=O)O)C/C=C\C=C(\C#N)[C@H](O)[C@@H](C)C[C@H](C)C1 view Borrelidin OH O O O HO N OH
E-492 23 0.54 0.51 0.69 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source C/C=C(\C)C(O)C(C)/C=C/C=C/CCC(O)CC1=C(C)C(=O)C(O)(C(C)O)O1 view E-492 OH OH O OH HO O
heronamide A 24 0.54 0.54 0.68 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CCC/C=C/C=C/C[C@@H]1C[C@H](O)C2[C@@H]3/C(C)=C\[C@@H]4C=C[C@H](O)[C@H](O)[C@H]4/C(C)=C\C=C/[C@H]3C(=O)N21 view heronamide A OH OH OH O N H H H H
Marneral 26 0.53 0.58 0.63 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@@]1(C)[C@H](CCC=O)C(=C(C)C)CC[C@H]1C view Marneral O
filipin 27 0.52 0.48 0.69 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CCCCC[C@@H](O)[C@H]1C(=O)O[C@H](C)[C@@H](O)/C=C\C=C/C=C\C=C/C=C(/C)[C@@H](O)C[C@H](O)C[C@H](O)C[C@H](O)C[C@H](O)C[C@H](O)C[C@@H]1O view filipin OH O O HO OH OH OH OH OH OH HO
pladienolide 28 0.52 0.53 0.64 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CC[C@H](O)[C@@H](C)[C@H]1O[C@H]1C[C@H](C)/C=C/C=C(\C)[C@H]1OC(=O)C[C@@H](O)CC[C@@](C)(O)[C@@H](OC(C)=O)/C=C\[C@@H]1C view pladienolide OH O O O OH OH O O
clavaric acid 29 0.52 0.53 0.64 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source C[C@H](CCC(O)C(C)(C)O)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)C[C@@H](OC(=O)CC(C)(O)CC(=O)O)C(=O)C(C)(C)[C@@H]1CC3 view clavaric acid HO OH O O HO O OH O H
tetrocarcin A 30 0.51 0.5 0.65 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source COC(=O)N[C@H]1[C@@H](C)O[C@@H](O[C@H]2C/C=C(/C)[C@@H]3C=C[C@@H]4[C@@H](O)[C@@H](C)C[C@H](C)[C@H]4[C@]3(C)C(=O)C3=C(O)OC4(CC(C=O)=C[C@H](O)[C@H]4/C=C\2C)C3=O)C[C@]1(C)[N+](=O)[O-] view tetrocarcin A O O NH O O OH O OH O O HO O N+ O O- H H H H
myxovirescin 31 0.5 0.52 0.6 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CCC[C@@H]1OC(=O)[C@@H](C)C[C@H](C)CCCCC(=O)CCC[C@@H](CC)/C=C\C=C(\COC)CC[C@@H](O)[C@@H](O)C[C@H](O)CNC1=O view myxovirescin O O O O OH OH OH NH O
patellazole 32 0.49 0.48 0.62 0.0 6-Ring:0/3 * Sphingo:0/1 * 5-Ring:0/3 MIBiG Source CCC(C)OC(=O)C1(C)CCC(C)CC(O)C(C)C(=O)C(C)/C=C\CC(C)C(O)C(O)C(OC)/C(C)=C\C=C/C(C)C(C(C)(O)/C=C(/C)Cc2csc(C3(C)OC3C)n2)OC1=O view patellazole